:GSK 299423

{{Chembox

| Verifiedfields = changed

| verifiedrevid = 443831253

| ImageFile = GSK 299423.png

| ImageFile2 = GSK299423 3D 2XCS.png

| ImageSize =

| ImageAlt =

| PIN = 6-Methoxy-4-[2-(4-{[(2H-[1,3]oxathiolo[5,4-c]pyridin-6-yl)methyl]amino}piperidin-1-yl)ethyl]quinoline-3-carbonitrile

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|PubChem}}

| CASNo = 1352149-24-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2Q0G81H7FK

| PubChem = 46835136

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 24751852

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NKXJSCXEAVZSMF-UHFFFAOYSA-N

| SMILES = COc1ccc2c(c1)c(c(cn2)C#N)CCN3CCC(CC3)NCc4cc5c(cn4)OCS5

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C25H27N5O2S/c1-31-20-2-3-23-22(11-20)21(17(12-26)13-29-23)6-9-30-7-4-18(5-8-30)27-14-19-10-25-24(15-28-19)32-16-33-25/h2-3,10-11,13,15,18,27H,4-9,14,16H2,1H3

}}

| Section2 = {{Chembox Properties

| C=25|H=27|N=5|O=2|S=1

| Appearance =

| Density =

| MeltingPt =

| Solubility = }}

| Section3 = {{Chembox Hazards

| MainHazards =

}}

}}

File:GSK 299423 with Staphylococcus aureus DNA gyrase PDB 2XCS.png DNA gyrase (teal) and a DNA fragment (orange). From {{PDB|2xcs}}.]]

GSK 299423 or GlaxoSmithKline 299423 is an antibiotic chemical compound that has been identified as potentially effective in treating patients infected with bacteria expressing the New Delhi metallo-beta-lactamase. The antibiotic inhibits the enzyme topoisomerase, which bacteria need to replicate.Sten Stovall, "[https://www.wsj.com/article/BT-CO-20100804-713606.html Glaxo:New Compound Offers Way To Fight Drug-Resistant Bacteria]{{Dead link|date=December 2022 |bot=InternetArchiveBot |fix-attempted=yes }}," The Wall Street Journal, August 4, 2010Melly Alazraki, "[http://www.dailyfinance.com/story/glaxosmithkline-finds-compound-fight-superbugs/19582888/ GlaxoSmithKline Finds Compound That Could Help Fight 'Superbugs'] {{Webarchive|url=https://web.archive.org/web/20100816035124/http://www.dailyfinance.com/story/glaxosmithkline-finds-compound-fight-superbugs/19582888/ |date=2010-08-16 }}" Daily Finance, August 6, 2010{{cite journal |journal=Nature |title=Type IIA topoisomerase inhibition by a new class of antibacterial agents |vauthors=Bax BD, etal |volume=466 |pages=935–40 |doi=10.1038/nature09197 |date=4 August 2010 |pmid=20686482 |issue=7309|bibcode=2010Natur.466..935B |s2cid=205221405 }} (primary source)

No animal studies have been reported. No application has been made for human clinical trials.{{citation needed|date=January 2023}}