:Ganoderic acid
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 428815571
| Name=Ganoderic acid A
| ImageFile=Ganoderic acid.png
| ImageSize=200px
| IUPACName = (25R)-7β,15α-Dihydroxy-3,11,23-trioxolanost-8-en-26-oic acid
| SystematicName = (2R,6R)-6-[(1R,3S,3aR,4S,5aR,9aS,11aR)-3,4-Dihydroxy-3a,6,6,9a,11a-pentamethyl-7,10-dioxo-2,3,3a,4,5,5a,6,7,8,9,9a,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl]-2-methyl-4-oxoheptanoic acid
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo=81907-62-2
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 548G37DF65
| PubChem=471002
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 413668
| SMILES = OC(=O)[C@H](C)CC(=O)C[C@@H](C)[C@H]2C[C@H](O)[C@@]1(C)C/3=C(\C(=O)C[C@@]12C)[C@@]4(C)CCC(=O)[C@](C)(C)[C@@H]4C[C@@H]\3O
| InChI = 1/C30H44O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h15-16,18-19,21,23,32,35H,8-14H2,1-7H3,(H,36,37)/t15-,16-,18-,19+,21+,23+,28+,29-,30+/m1/s1
| InChIKey = DYOKDAQBNHPJFD-JNTBEZBXBK
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C30H44O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h15-16,18-19,21,23,32,35H,8-14H2,1-7H3,(H,36,37)/t15-,16-,18-,19+,21+,23+,28+,29-,30+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = DYOKDAQBNHPJFD-JNTBEZBXSA-N
}}
|Section2={{Chembox Properties
| Formula=C30H44O7
| MolarMass=516.67
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Ganoderic acids are a class of closely related triterpenoids (derivatives from lanosterol) found in Ganoderma mushrooms. For thousands of years, the fruiting bodies of Ganoderma fungi have been used in traditional medicines in East Asia.{{cite journal |doi=10.1016/0031-9422(89)85036-8 |title=Bitter triterpenoids from the fungus Ganoderma applanatum |journal=Phytochemistry |volume=28 |issue=1 |pages=193–7 |year=1989 |last1=Nishitoba |first1=Tsuyoshi |last2=Goto |first2=Sanae |last3=Sato |first3=Hiroji |last4=Sakamura |first4=Sadao |bibcode=1989PChem..28..193N }} Consequently, there have been efforts to identify the chemical constituents that may be responsible for the putative pharmacological effects. The two most well described ganoderic acids out of the many that have been identified and characterized are ganoderic acids A and B. Some ganoderic acids have been found to possess biological activities including hepatoprotection,{{cite journal |doi=10.1016/j.fitote.2014.08.004 |pmid=25111010 |title=Triterpenoids of Ganoderma theaecolum and their hepatoprotective activities |journal=Fitoterapia |volume=98 |pages=254–9 |year=2014 |last1=Liu |first1=Li-Ying |last2=Chen |first2=Hui |last3=Liu |first3=Chao |last4=Wang |first4=Hong-Qing |last5=Kang |first5=Jie |last6=Li |first6=Yan |last7=Chen |first7=Ruo-Yun }} anti-tumor effects, and 5-alpha reductase inhibition.
References
{{Reflist |refs=
| last1 = Mizuno | first1 = T.
| last2 = Wang | first2 = G.
| last3 = Zhang | first3 = J.
| last4 = Kawagishi | first4 = H.
| last5 = Nishitoba | first5 = T.
| last6 = Li | first6 = J.
| doi = 10.1080/87559129509541025
| title = Reishi, Ganoderma lucidum and Ganoderma tsugae: Bioactive substances and medicinal effects
| journal = Food Reviews International
| volume = 11
| pages = 151–166
| year = 1995
}} {{closed access}}
| last1 = Wang | first1 = G.
| last2 = Zhao | first2 = J.
| last3 = Liu | first3 = J.
| last4 = Huang | first4 = Y.
| last5 = Zhong | first5 = J. J.
| last6 = Tang | first6 = W.
| doi = 10.1016/j.intimp.2007.02.006
| title = Enhancement of IL-2 and IFN-γ expression and NK cells activity involved in the anti-tumor effect of ganoderic acid Me in vivo
| journal = International Immunopharmacology
| volume = 7
| issue = 6
| pages = 864–870
| year = 2007
| pmid = 17466920
}} {{closed access}}
| last1 = Liu | first1 = J.
| last2 = Kurashiki | first2 = K.
| last3 = Shimizu | first3 = K.
| last4 = Kondo | first4 = R.
| title = Structure–activity relationship for inhibition of 5α-reductase by triterpenoids isolated from Ganoderma lucidum
| doi = 10.1016/j.bmc.2006.08.018
| journal = Bioorganic & Medicinal Chemistry
| volume = 14
| issue = 24
| pages = 8654–8660
| date=December 2006
| pmid = 16962782
}} {{closed access}}
}}