:Gemopatrilat

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (6S)-Hexahydro-6-[(αS)-α-mercaptohydrocinnamido]-2,2-dimethyl-7-oxo-1H-azepine-1-acetic acid

| image = Gemopatrilat.svg

| width =

| tradename =

| Drugs.com =

| licence_US =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 160135-92-2

| ATC_prefix = None

| ATC_suffix =

| PubChem = 9886079

| ChemSpiderID = 8061752

| UNII = MU9089C77W

| KEGG = D04312

| ChEMBL = 107747

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = BMS-189921

| chemical_formula =

| C = 19 | H = 26 | N=2 | O=4 | S=1

| molecular_weight =

| smiles = CC1(CCC[C@@H](C(=O)N1CC(=O)O)NC(=O)[C@H](CC2=CC=CC=C2)S)C

| StdInChI = 1S/C19H26N2O4S/c1-19(2)10-6-9-14(18(25)21(19)12-16(22)23)20-17(24)15(26)11-13-7-4-3-5-8-13/h3-5,7-8,14-15,26H,6,9-12H2,1-2H3,(H,20,24)(H,22,23)/t14-,15-/m0/s1

| StdInChIKey = YRSVDSQRGBYVIY-GJZGRUSLSA-N

}}

Gemopatrilat (INN){{cite web | title = International Nonproprietary Names for Pharmaceutical Substances (INN). Recommended International Nonproprietary Names: List 46 | url =https://www.who.int/medicines/publications/druginformation/innlists/RL64.pdf | publisher = World Health Organization | access-date = 2 March 2017 | page = 200}} is an experimental drug that was never marketed.{{cite web | url = http://adisinsight.springer.com/drugs/800009581 | title = Gemopatrilat | publisher = AdisInsight | quote = Highest Development Phases: Discontinued}} It acts as a vasopeptidase inhibitor.{{Cite journal |vauthors=Laverman GD, Van Goor H, Henning RH, De Jong PE, De Zeeuw D, Navis G |date=January 2003 |title=Renoprotective effects of VPI versus ACEI in normotensive nephrotic rats on different sodium intakes |url=https://www.kidney-international.org/article/S0085-2538(15)48845-3/fulltext |journal=Kidney International |volume=63 |issue=1 |pages=64–71 |doi=10.1046/j.1523-1755.2003.00708.x |pmid=12472769 |doi-access=free}}{{cite journal | vauthors = Wait JC, Vaccharajani N, Mitroka J, Jemal M, Khan S, Bonacorsi SJ, Rinehart JK, Iyer RA | display-authors = 6 | title = Metabolism of [14C]gemopatrilat after oral administration to rats, dogs, and humans | journal = Drug Metabolism and Disposition | volume = 34 | issue = 6 | pages = 961–70 | date = June 2006 | pmid = 16540589 | doi = 10.1124/dmd.105.007500 | s2cid = 25629874 }} It inhibits both angiotensin-converting enzyme (ACE) and neutral endopeptidase (neprilysin).{{cite journal | vauthors = Hubner RA, Kubota E, Casley DJ, Johnston CI, Burrell LM | title = In-vitro and in-vivo inhibition of rat neutral endopeptidase and angiotensin converting enzyme with the vasopeptidase inhibitor gemopatrilat | journal = Journal of Hypertension | volume = 19 | issue = 5 | pages = 941–6 | date = May 2001 | pmid = 11393678 | doi = 10.1097/00004872-200105000-00015 | s2cid = 9162678 }}