:Glyceollin III

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 423638954

| Name = Glyceollin III

| ImageFile = Glyceollin III.svg

| ImageSize = 200px

| ImageName = Chemical structure of glyceollin III

| ImageAlt = Chemical structure of glyceollin III

| PIN = (2S,6aS,11aS)-2-(Prop-1-en-2-yl)-1,2-dihydro-6H-[1]benzofuro[3,2-c]furo[3,2-g][1]benzopyran-6a,9(11aH)-diol

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 61080-23-7

| CASNoOther =

| PubChem = 11954193

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 10128488

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2229450

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 52086

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 629FG6XLLL

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C15511

| SMILES = CC(=C)[C@@H]1Cc2cc3c(cc2O1)OC[C@@]4([C@H]3Oc5c4ccc(c5)O)O

| InChI = 1S/C20H18O5/c1-10(2)15-6-11-5-13-17(8-16(11)24-15)23-9-20(22)14-4-3-12(21)7-18(14)25-19(13)20/h3-5,7-8,15,19,21-22H,1,6,9H2,2H3/t15-,19-,20+/m0/s1

| InChIKey = MIYTVBARXCVVHZ-RYGJVYDSSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| Formula = C₂₀H₁₈O₅

| MolarMass = 338.35 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| GHS_ref =

}}

}}

Glyceollin III is a glyceollin, a type of pterocarpan, found in the soybean (Glycine max).{{cite journal | doi = 10.1124/jpet.109.160382 | title = Glyceollin I, a Novel Antiestrogenic Phytoalexin Isolated from Activated Soy | date = 2010 | last1 = Zimmermann | first1 = M. Carla | last2 = Tilghman | first2 = Syreeta L. | last3 = Boué | first3 = Stephen M. | last4 = Salvo | first4 = Virgilio A. | last5 = Elliott | first5 = Steven | last6 = Williams | first6 = K. Y. | last7 = Skripnikova | first7 = Elena V. | last8 = Ashe | first8 = Hasina | last9 = Payton-Stewart | first9 = Florastina | last10 = Vanhoy-Rhodes | first10 = Lyndsay | last11 = Fonseca | first11 = Juan Pablo | last12 = Corbitt | first12 = Cynthia | last13 = Collins-Burow | first13 = Bridgette M. | last14 = Howell | first14 = Melanie H. | last15 = Lacey | first15 = Michelle | last16 = Shih | first16 = Betty Y. | last17 = Carter-Wientjes | first17 = Carol | last18 = Cleveland | first18 = Thomas E. | last19 = McLachlan | first19 = John A. | last20 = Wiese | first20 = Thomas E. | last21 = Beckman | first21 = Barbara S. | last22 = Burow | first22 = Matthew E. | journal = Journal of Pharmacology and Experimental Therapeutics | volume = 332 | issue = 1 | pages = 35–45 | pmid = 19797619 | pmc = 2802480 }}{{cite journal | doi = 10.1016/S0031-9422(00)97682-9 | title = Biosynthesis of glyceollins I, II and III in soybean | date = 1983 | last1 = Banks | first1 = Stephen W. | last2 = Dewick | first2 = Paul M. | journal = Phytochemistry | volume = 22 | issue = 12 | pages = 2729–2733 }} It has an antiestrogenic effect.{{cite journal | url = http://cat.inist.fr/?aModele=afficheN&cpsidt=18353411 | title = Antiestrogenic glyceollins suppress human breast and ovarian carcinoma tumorigenesis | author = Salvo Virgilo A., Boue Stephen M., Fonseca Juan P., Elliott Steven, Corbitt Cynthia, Collins-Burow Bridgette M., Curiel Tyler J., Srivastav Sudesh K., Shih Betty Y., Carter-Wientjes Carol, Wood Charles E., Erhardt Paulw., Beckman Barbara S., McLachlan John A., Cleveland Thomas E. and Burow Matthew E. | journal = Clinical Cancer Research | date = 2006 | volume = 12 | issue = 23 | pages = 7159–7164 | doi = 10.1158/1078-0432.CCR-06-1426 | pmid = 17145841 | url-access = subscription }} In soil, it has an antifungal activity against Aspergillus sojae.{{cite journal | doi = 10.1021/jf101694t | title = Antifungal Activity of Glyceollins Isolated from Soybean Elicited with Aspergillus sojae | date = 2010 | last1 = Kim | first1 = Hyo Jung | last2 = Suh | first2 = Hwa-Jin | last3 = Lee | first3 = Choong Hwan | last4 = Kim | first4 = Jeong Hwan | last5 = Kang | first5 = Sun Chul | last6 = Park | first6 = Sunmin | last7 = Kim | first7 = Jong-Sang | journal = Journal of Agricultural and Food Chemistry | volume = 58 | issue = 17 | pages = 9483–9487 | pmid = 20666365 }}