:Guanacastepene A

{{chembox

| verifiedrevid = 418284282

| ImageFile = Guanacastepene A.png

| ImageSize = 200px

| PIN = (1R,2R,6S,8aR,10aR)-5-Formyl-6-hydroxy-8a,10a-dimethyl-3-oxo-1-(propan-2-yl)-1,2,3,6,7,8,8a,9,10,10a-decahydrobenzo[f]azulen-2-yl acetate

| OtherNames =

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 8560244

| InChI = 1/C22H30O5/c1-12(2)18-20(27-13(3)24)19(26)16-10-15-14(11-23)17(25)6-7-21(15,4)8-9-22(16,18)5/h10-12,17-18,20,25H,6-9H2,1-5H3/t17-,18-,20+,21-,22-/m0/s1

| InChIKey = KCPNSIPCHJTGHJ-MYHSIESUBP

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 263357-41-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = G5H7ZB2HDF

| PubChem = 10384802

| StdInChI = 1S/C22H30O5/c1-12(2)18-20(27-13(3)24)19(26)16-10-15-14(11-23)17(25)6-7-21(15,4)8-9-22(16,18)5/h10-12,17-18,20,25H,6-9H2,1-5H3/t17-,18-,20+,21-,22-/m0/s1

| StdInChIKey = KCPNSIPCHJTGHJ-MYHSIESUSA-N

| SMILES = O=C\C3=C2/C=C1/C(=O)[C@H](OC(=O)C)[C@@H]([C@]1(CC[C@@]2(CC[C@@H]3O)C)C)C(C)C

}}

|Section2={{Chembox Properties

| C=22 | H=30 | O=5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Guanacastepene A is a compound showing antibiotic activity. It is a diterpene that was extracted with hexane from a Costa Rican fungus, CR115, found on the branches of the Daphnopsis americana tree and purified by chromatography.{{cite journal |author1=Brady, Sean F.|author2=Singh, Maya P.|author3=Janso, Jeff E.|author4=Clardy, Jon | title = Guanacastepene, a Fungal-Derived Diterpene Antibiotic with a New Carbon Skeleton | journal = Journal of the American Chemical Society | year = 2000 | volume = 122 | issue = 9 | pages = 2116–2117 | doi = 10.1021/ja993835m}}