:Hexaborane(12)

{{Chembox

| ImageFile = B6H12.png

| ImageSize =

| ImageAlt =

| ImageFile1 = Hexaborane(12)-GED-view-1-3D-bs-17.png

| IUPACName =

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cite web |title=Hexaborane(12) |url=https://webbook.nist.gov/cgi/formula?ID=C12008194 |website=webbook.nist.gov |publisher=National Institute of Standards and Technology |language=en}}

| CASNo = 12008-19-4

| RTECS =

| EINECS =

| StdInChI=1S/B6H12/c7-1-3-4(5(1,3,7)10-4)2-6(3,4,8-2)9-3/h3-6H,1-2H2

| StdInChIKey =ZMLJCODVOXNMHE-UHFFFAOYSA-N

| SMILES = [BH2]12[BH]34([H]1)[BH]256[BH]38([H]4)[BH]75([H]6)[BH2]8[H]7

}}

| Section2 = {{Chembox Properties

| B=6 | H=12

| Appearance = colorless liquid

| Density =

| MeltingPtC = -82.3

| MeltingPt_ref =

| BoilingPt = {{convert|85|C|F K}} (approx)

| BoilingPt_ref =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Hexaborane(12) is an inorganic compound with the formula B₆H₁₂. It is an obscure member of the boranes. It is a colorless liquid that, like some other boron hydride clusters, is readily hydrolyzed and flammable.

The molecular structure conforms to C₂ symmetry group. With the formula B_nH_n+6, it is classified as an arachno-cluster. As such the boron positions match six of the boron positions in the closo-B₈H{{su|b=8|p=2−}}.