:Hirsutidin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424926720

| Name = Hirsutidin

| ImageFile = Hirsutidin.svg

| ImageSize = 250px

| IUPACName = 3,4′,5-Trihydroxy-3′,5′,7-trimethoxyflavylium

| SystematicName = 3,5-Dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-7-methoxy-1λ⁴-benzopyran-1-ylium

| OtherNames =

|Section1={{Chembox Identifiers

| index2_label = (chloride)

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 151776-57-7

| CASNo2_Ref = {{cascite|correct|CAS}}

| CASNo2 = 4092-66-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = VV9H579AR2

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = UX37SFW7Y9

| PubChem = 441694

| SMILES = Oc1cc2c(O)cc(OC)cc2[o+]c1c3cc(OC)c(O)c(OC)c3

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 390303

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 5728

| InChI = 1/C18H16O7/c1-22-10-6-12(19)11-8-13(20)18(25-14(11)7-10)9-4-15(23-2)17(21)16(5-9)24-3/h4-8H,1-3H3,(H2-,19,20,21)/p+1

| InChIKey = JGPCLGHKWGCWNO-IKLDFBCSAS

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C18H16O7/c1-22-10-6-12(19)11-8-13(20)18(25-14(11)7-10)9-4-15(23-2)17(21)16(5-9)24-3/h4-8H,1-3H3,(H2-,19,20,21)/p+1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = JGPCLGHKWGCWNO-UHFFFAOYSA-O

}}

|Section2={{Chembox Properties

| Formula = C₁₈H₁₇O₇+

| MolarMass = 345.32 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Hirsutidin is an O-methylated anthocyanidin, a chemical compound belonging to the anthocyanins. It can be found in Catharanthus roseus[https://archive.today/20130105063940/http://www3.interscience.wiley.com/journal/5021/abstract?CRETRY=1&SRETRY=0 Characterization of the anthocyanins of Catharanthus roseus (L.) G. Don in vivo and in vitro by electrospray ionization ion trap mass spectrometry, Anna Piovan, Raffaella Filippini, Donata Favretto, 1998] (Madagascar periwinkle) where it is the prominent compound in petals and can also be found in callus cultures.[http://www.biologie.uni-freiburg.de/data/bio2/schroeder/Plant_Catharanthus_Flavonoids.html Catharanthus flavonoids on Schroeder page, uni. Freiburg, Germany]