:Hispolon

{{Chembox

| ImageFile = Hispolon.svg

| ImageSize = 150px

| ImageAlt =

| IUPACName = 6-(3,4-Dihydroxyphenyl)-4-hydroxyhexa-3,5-dien-2-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 173933-40-9

| CASNo_Ref = {{Cascite|changed|CAS}}

| ChemSpiderID = 24764567

| PubChem = 53395354

| ChEMBL = 452722

| InChI=1S/C12H12O4/c1-8(13)6-10(14)4-2-9-3-5-11(15)12(16)7-9/h2-7,14-16H,1H3

| InChIKey = QDVIEIMMEUCFMW-UHFFFAOYSA-N

| SMILES = CC(=O)C=C(C=CC1=CC(=C(C=C1)O)O)O}}

|Section2={{Chembox Properties

| C=12 | H=12 | O=4

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Hispolon is a bio-active isolate of Phellinus linteus.{{cite journal|pmid=24228611|year=2013|last1=Chen|first1=YC|authorlink2=Howard Y. Chang|last2=Chang|first2=HY|last3=Deng|first3=JS|last4=Chen|first4=JJ|last5=Huang|first5=SS|last6=Lin|first6=IH|last7=Kuo|first7=WL|last8=Chao|first8=W|last9=Huang|first9=GJ|title=Hispolon from Phellinus linteus Induces G0/G1 Cell Cycle Arrest and Apoptosis in NB4 Human Leukaemia Cells|volume=41|issue=6|pages=1439–57|doi=10.1142/S0192415X13500961|journal=The American Journal of Chinese Medicine}}