:Intriptyline

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| image = Intriptyline.png

| alt = Skeletal formula of intriptyline

| width = 200

| image2 = Intriptyline-3D-spacefill.png

| alt2 = Space-filling model of the intriptyline molecule

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 27466-27-9

| ATC_prefix = none

| ATC_suffix =

| PubChem = 71397

| ChemSpiderID = 64489

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = GU9MLT8VE0

| ChEMBL = 2110677

| IUPAC_name = N,N-dimethyl-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)but-2-yn-1-amine

| C=21 | H=19 | N=1

| smiles = C(#C\C=C3/c1ccccc1\C=C/c2c3cccc2)CN(C)C

| StdInChI = 1S/C21H19N/c1-22(2)16-8-7-13-21-19-11-5-3-9-17(19)14-15-18-10-4-6-12-20(18)21/h3-6,9-15H,16H2,1-2H3

| StdInChIKey = OKCODFSHDQKCQN-UHFFFAOYSA-N

}}

Intriptyline is a tricyclic antidepressant (TCA) that was never marketed.{{cite book | url = https://books.google.com/books?id=A0THacd46ZsC&q=intriptyline%20antidepressant%20-triptyline%20-amitriptyline&pg=PA1140 | title = Dictionary of pharmacological agents - Google Books | isbn = 978-0-412-46630-4 | vauthors = Ganellin CR, Triggle DJ, MacDonald F | year = 1997| publisher = CRC Press }}