:Iodophenpropit

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 400753856

| ImageFile = Iodophenpropit.svg

| ImageSize = 240

| IUPACName = 3-(1H-imidazol-5-yl)propyl N'-[2-(4-iodophenyl)ethyl]imidothiocarbamate

| OtherNames = 1-[3-(3H-imidazol-4-yl)propylthio]-N'-[2-(4-iodophenyl)ethyl]formamidine

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=145196-88-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3SH45L9H3Z

| PubChem=3035746

| ChemSpiderID=2299913

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 498770

| SMILES=C1=CC(=CC=C1CCN=C(N)SCCCC2=CN=CN2)I

| MeSHName=Iodophenpropit

}}

| Section2 = {{Chembox Properties

| Formula = C₁₅H₁₉IN₄S

| MolarMass = 414.30763 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Iodophenpropit is a histamine antagonist which binds selectively to the H₃ subtype. Its ¹²⁵I radiolabelled form has been used for mapping the distribution of H₃ receptors in animal studies.{{cite journal | last1 = Jansen | first1 = FP | last2 = Wu | first2 = TS | last3 = Voss | first3 = HP | last4 = Steinbusch | first4 = HW | last5 = Vollinga | first5 = RC | last6 = Rademaker | first6 = B | last7 = Bast | first7 = A | last8 = Timmerman | first8 = H | title = Characterization of the binding of the first selective radiolabelled histamine H3-receptor antagonist, 125I-iodophenpropit, to rat brain | journal = British Journal of Pharmacology | volume = 113 | issue = 2 | pages = 355–62 | year = 1994 | pmid = 7834183 | pmc = 1510107 | doi=10.1111/j.1476-5381.1994.tb16995.x}}{{cite journal | last1 = Jansen | first1 = FP | last2 = Mochizuki | first2 = T | last3 = Maeyama | first3 = K | last4 = Leurs | first4 = R | last5 = Timmerman | first5 = H | title = Characterization of histamine H3 receptors in mouse brain using the H3 antagonist 125Iiodophenpropit | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 362 | issue = 1 | pages = 60–7 | year = 2000 | pmid = 10935534 | doi = 10.1007/s002100000227 | s2cid = 21293180 }}