:Isopentenyl pyrophosphate

{{chembox

| verifiedrevid = 451189391

| ImageFile = Isopentenyl pyrophosphate.svg

| ImageSize = 210px

| ImageName = Skeletal formula of IPP

| ImageFile1 = Isopentenyl-pyrophosphate-3D-balls.png

| ImageSize1 = 220px

| ImageName1 = Ball-and-stick model of IPP

| IUPACName = (Hydroxy-(3-methylbut-3-enoxy) phosphoryl)oxyphosphonic acid

| OtherNames =

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 1158

| StdInChI_Ref = {{stdinchicite|correct|Pubchem}}

| StdInChI = InChI=1S/C5H12O7P2/c1-5(2)3-4-11-14(9,10)12-13(6,7)8/h1,3-4H2,2H3,(H,9,10)(H2,6,7,8)

| StdInChIKey_Ref = {{stdinchicite|correct|Pubchem}}

| StdInChIKey = NUHSROFQTUXZQQ-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=358-71-4

| PubChem = 1195

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 128769

| SMILES = CC(=C)CCOP(=O)(O)OP(=O)(O)O

| MeSHName=isopentenyl+pyrophosphate

}}

|Section2={{Chembox Properties

| C=5|H=12|O=7|P=2

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Isopentenyl pyrophosphate (IPP, isopentenyl diphosphate, or IDP){{cite journal|url=http://pubs.rsc.org/en/Content/ArticleLanding/2014/NP/C3NP70124G|title=Methylerythritol 4-phosphate (MEP) pathway metabolic regulation|first1=A.|last1=Banerjee|first2=T. D.|last2=Sharkey|date=9 July 2014|journal=Natural Product Reports|volume=31|issue=8|doi=10.1039/C3NP70124G|pages=1043–1055|pmid=24921065}} is an isoprenoid precursor. IPP is an intermediate in the classical, HMG-CoA reductase pathway (commonly called the mevalonate pathway) and in the non-mevalonate MEP pathway of isoprenoid precursor biosynthesis. Isoprenoid precursors such as IPP, and its isomer DMAPP, are used by organisms in the biosynthesis of terpenes and terpenoids.