:JWH-167

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 461782419

| ImageFile = JWH-167.svg

| ImageSize = 150px

| ImageAlt =

| PIN = 1-(1-Pentyl-1H-indol-3-yl)-2-phenylethan-1-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 864445-37-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = LQX1W3537N

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 365878

| PubChem = 44397502

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 23256084

| SMILES = CCCCCn1cc(c2c1cccc2)C(=O)Cc3ccccc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI=1S/C21H23NO/c1-2-3-9-14-22-16-19(18-12-7-8-13-20(18)22)21(23)15-17-10-5-4-6-11-17/h4-8,10-13,16H,2-3,9,14-15H2,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = AMCPOEOUXQWESI-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=21 | H=23 | N=1 | O=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

| Section6 = {{Chembox Pharmacology

| legal_US = Schedule I

}}

}}

JWH-167 (1-pentyl-3-(phenylacetyl)indole) is a synthetic cannabinoid from the phenylacetylindole family, which acts as a cannabinoid agonist with about 1.75 times selectivity for CB₁ with a K_i of 90 nM ± 17 and 159 nM ± 14 at CB₂. Similar to the related 2'-methoxy compound JWH-250, and the 2'-chloro compound JWH-203, JWH-167 has a phenylacetyl group in place of the naphthoyl ring used in most aminoalkylindole cannabinoid compounds.{{cite journal | vauthors = Huffman JW, Szklennik PV, Almond A, Bushell K, Selley DE, He H, Cassidy MP, Wiley JL, Martin BR | display-authors = 6 | title = 1-Pentyl-3-phenylacetylindoles, a new class of cannabimimetic indoles | journal = Bioorganic & Medicinal Chemistry Letters | volume = 15 | issue = 18 | pages = 4110–3 | date = September 2005 | pmid = 16005223 | doi = 10.1016/j.bmcl.2005.06.008 }}{{cite journal | vauthors = Manera C, Tuccinardi T, Martinelli A | title = Indoles and related compounds as cannabinoid ligands | journal = Mini Reviews in Medicinal Chemistry | volume = 8 | issue = 4 | pages = 370–87 | date = April 2008 | pmid = 18473928 | doi = 10.2174/138955708783955935 }}

In the United States, CB₁ receptor agonists of the 3-phenylacetylindole class such as JWH-167 are Schedule I Controlled Substances.{{UnitedStatesCode2|21|812|Schedules of controlled substances}}