:JZL195
{{Chembox
| ImageFile = JZL-195 Structure.svg
| ImageSize =
| PIN = 4-Nitrophenyl 4-[(3-phenoxyphenyl)methyl]piperazine-1-carboxylate
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 1210004-12-8
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = TP6P2HKJ54
| PubChem = 46232606
| ChemSpiderID = 24655100
| ChEMBL = 606201
| SMILES = c1ccc(cc1)Oc2cccc(c2)CN3CCN(CC3)C(=O)Oc4ccc(cc4)[N+](=O)[O-]
| StdInChI = 1S/C24H23N3O5/c28-24(32-22-11-9-20(10-12-22)27(29)30)26-15-13-25(14-16-26)18-19-5-4-8-23(17-19)31-21-6-2-1-3-7-21/h1-12,17H,13-16,18H2
| StdInChIKey = QNYRAEKLMNDRFY-UHFFFAOYSA-N
}}
|Section2={{Chembox Properties
| C=24 | H=23 | N=3 | O=5
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
JZL195 is a potent inhibitor of both fatty acid amide hydrolase (FAAH) and monoacylglycerol lipase (MAGL), the primary enzymes responsible for degrading the endocannabinoids anandamide (AEA) and 2-arachidonoylglycerol (2-AG), respectively.{{cite journal | vauthors = Long JZ, Nomura DK, Vann RE, Walentiny DM, Booker L, Jin X, Burston JJ, Sim-Selley LJ, Lichtman AH, Wiley JL, Cravatt BF | title = Dual blockade of FAAH and MAGL identifies behavioral processes regulated by endocannabinoid crosstalk in vivo | journal = Proceedings of the National Academy of Sciences of the United States of America | volume = 106 | issue = 48 | pages = 20270–5 | date = December 2009 | pmid = 19918051 | pmc = 2787168 | doi = 10.1073/pnas.0909411106 | bibcode = 2009PNAS..10620270L | doi-access = free }}