:Kaempferol 3-O-rutinoside

{{DISPLAYTITLE:Kaempferol 3-O-rutinoside}}

{{chembox

| Name = Kaempferol 3-O-rutinoside

| Verifiedfields =

| verifiedrevid =

| ImageFile = Kaempferol 3-O-rutinoside.svg

| ImageSize = 200px

| IUPACName = 7-[(2S,3R,4S,5S,6R)-4,5-Dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,5-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one

| OtherNames = Kaempferol 3-O-rutinoside
Kaempferol 3-O-rhamnosyl-glucoside
Nicotiflorin
Kaempferol-3-O-β-D-glucopyranoside-7-O-α-L-rhamnopyranoside
Kaempferol 7-neohesperidoside

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 31921-42-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4056D20K3H

| CASNo1 = 31921-42-3

| ChEBI = 69657

| KEGG = C21833

| EINECS = 241-377-3

| CASNo2 = 17650-84-9

| PubChem1 = 5318767

| PubChem2 = 5483905

| ChemSpiderID = 4477257

| SMILES = C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)Oc3c(=O)c4c(cc(cc4oc3c5ccc(cc5)O)O)O)O)O)O)O)O)O

| InChI = 1/C27H30O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-12(29)7-14(16)40-24(25)10-2-4-11(28)5-3-10/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15+,17-,18+,20+,21-,22+,23+,26+,27-/m0/s1

| InChIKey = RTATXGUCZHCSNG-QHWHWDPRBU

| StdInChI = 1S/C27H30O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-12(29)7-14(16)40-24(25)10-2-4-11(28)5-3-10/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15+,17-,18+,20+,21-,22+,23+,26+,27-/m0/s1

| StdInChIKey = RTATXGUCZHCSNG-QHWHWDPRSA-N

}}

|Section2={{Chembox Properties

| Formula = C₂₇H₃₀O₁₅

| MolarMass = 594.52 g/mol

| Appearance =

| Density = 1.762 g/mL

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Kaempferol-3-O-rutinoside is a bitter-tasting flavonol glycoside. It can be isolated from the rhizomes of the fern Selliguea feei.{{Cite journal | doi = 10.1016/S0031-9422(00)97105-X | title = Flavonoids and a proanthocyanidin from rhizomes of Selliguea feei | journal = Phytochemistry | volume = 36 | issue = 2 | pages = 513–518 | year = 1994 | last1 = Baek | first1 = Nam-In | last2 = Kennelly | first2 = Edward J. | last3 = Kardono | first3 = Leonardus B.S. | last4 = Tsauri | first4 = Soefjan | last5 = Padmawinata | first5 = Kosasih | last6 = Doel Soejarto | first6 = D. | last7 = Douglas Kinghorn | first7 = A. }} {{INIST|3300075}}