:Kojibiose
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477168858
| ImageFile=kojibiose.png
| ImageSize=200px
| IUPACName=2-O-α-D-Glucopyranosyl-D-glucose
|SystematicName=(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanal
| OtherNames=2-alpha-D-glucosyl-D-glucose
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 144601
| InChI = 1/C12H22O11/c13-1-4(16)7(17)8(18)5(2-14)22-12-11(21)10(20)9(19)6(3-15)23-12/h2,4-13,15-21H,1,3H2/t4-,5+,6-,7-,8-,9-,10+,11-,12+/m1/s1
| InChIKey = PZDOWFGHCNHPQD-OQPGPFOOBS
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H22O11/c13-1-4(16)7(17)8(18)5(2-14)22-12-11(21)10(20)9(19)6(3-15)23-12/h2,4-13,15-21H,1,3H2/t4-,5+,6-,7-,8-,9-,10+,11-,12+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PZDOWFGHCNHPQD-OQPGPFOOSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=2140-29-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9R6V2933TB
| PubChem=164939
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 33020
| SMILES = O=C[C@H](O[C@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)[C@@H](O)[C@H](O)[C@H](O)CO
| MeSHName=Kojibiose
}}
|Section2={{Chembox Properties
| Formula=C12H22O11
| MolarMass=342.30 g/mol
| Appearance=
| Density= 1.688 g/mL
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Kojibiose is a disaccharide. It is a product of the caramelization of glucose.{{Cite journal|doi =10.1111/j.1365-2621.1966.tb01905.x|title =The Thermal Degradation of Sugars I. Thermal Polymerization of Glucose|year =1966|last1 =Sugisawa|first1 =Hirqshi|last2 =Edo|first2 =Hiroshi|journal =Journal of Food Science|volume =31|issue =4|pages =561}} It is also present in honey (approx. 3%).{{cite journal |first1=I.R |last1=Siddiqua |first2=B |last2=Furgala |year=1967 |title=Isolation and characterization of oligosaccharides from honey |journal= Journal of Apicultural Research |volume=6 | issue=3 |pages=139–145|doi=10.1080/00218839.1967.11100174 }}
Kojibiose has a mild sweet taste, but low calorie count. In combination with its prebiotic properties, kojibiose could function as a sugar substitute. However, kojibiose is hard to synthesize on an industrial scale.
Recently, two enzyme approaches transforming sucrose and lactose or sucrose and glucose into kojibiose have been developed, potentially solving the synthetization problem. {{Cite journal|doi =10.1039/C3GC42246A|title =A sustainable biotechnological process for the efficient synthesis of kojibiose |year =2014|last1 =Diez-Municio|first1 =Marina | last2 =Montilla | first2 =Antonia | last3 =Moreno|first3 =F. Javier | last4 =Herrero | first4 =Miguel |journal =Green Chemistry|volume =16|issue =4|pages =2219–2226|hdl =10261/99797|hdl-access =free}}