:Kopsanone
{{Chembox
| ImageFile = Kopsanone.svg
| ImageSize = 150px
| ImageAlt =
| IUPACName = 5,14-diazaheptacyclo[12.5.3.01,13.04,12.04,18.06,11.012,16]docosa-6,8,10-trien-17-one
| OtherNames = Kopsan-22-one
|Section1={{Chembox Identifiers
| CASNo = 6662-83-5
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 3GFZ578CMF
| ChemSpiderID = 383767
| PubChem = 433961
| StdInChI=1S/C20H22N2O/c23-16-13-10-18-6-3-9-22-11-14(16)20(17(18)22)12-4-1-2-5-15(12)21-19(13,20)8-7-18/h1-2,4-5,13-14,17,21H,3,6-11H2
| StdInChIKey = RFDVSXYPLPEIGZ-UHFFFAOYSA-N
| SMILES = C1CC23CCC45C(C2)C(=O)C6C4(C3N(C1)C6)C7=CC=CC=C7N5
}}
|Section2={{Chembox Properties
| C=20|H=22|N=2|O=1
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Kopsanone is an alkaloid isolated from Aspidosperma.{{cite journal | pmid = 17252481 | title = Alkaloids from Aspidosperma species from Bolivia | doi=10.1055/s-2006-957939 | volume=62 | year=1996 | journal=Planta Med. | pages=458–61 | last1 = Mitaine | first1 = AC | last2 = Mesbah | first2 = K | last3 = Richard | first3 = B | last4 = Petermann | first4 = C | last5 = Arrazola | first5 = S | last6 = Moretti | first6 = C | last7 = Zèches-Hanrot | first7 = M | last8 = Men-Olivier | first8 = LL| issue = 5 }}
References
{{reflist}}
Extra reading
- {{cite journal |last1=Klein-Júnior |first1=Lc |last2=Bannwart |first2=G |last3=Kato |first3=L |last4=Oliveira |first4=Cma |last5=Gontijo |first5=B |last6=Silva |first6=Cc |last7=Ferreira |first7=Hd |last8=Vander Heyden |first8=Y |last9=Passos |first9=Cs |last10=Henriques |first10=At |last11=Santin |first11=Smo |title=Kopsanone and N(4)-oxide-kopsanone: two β-carbolinic indole alkaloids with monoamine oxidase A inhibitory activity |journal=Planta Medica |date=25 November 2015 |volume=81 |issue=16 |pages=s–0035–1565743 |doi=10.1055/s-0035-1565743}}
- {{cite journal |last1=Craven |first1=B. M. |title=The crystal structure and absolute configuration of the N ( b )-methiodide of (−)-kopsanone |journal=Acta Crystallographica Section B: Structural Crystallography and Crystal Chemistry |date=1 October 1969 |volume=25 |issue=10 |pages=2131–2139 |doi=10.1107/S0567740869005243}}
- {{cite journal |last1=Leng |first1=Lingying |last2=Zhou |first2=Xiaohan |last3=Liao |first3=Qi |last4=Wang |first4=Falu |last5=Song |first5=Hao |last6=Zhang |first6=Dan |last7=Liu |first7=Xiao-Yu |last8=Qin |first8=Yong |title=Asymmetric Total Syntheses of Kopsia Indole Alkaloids |journal=Angewandte Chemie International Edition |date=20 March 2017 |volume=56 |issue=13 |pages=3703–3707 |doi=10.1002/anie.201700831}}
- {{cite journal |last1=Layne |first1=Tanya H. |last2=Roach |first2=Joy S. |last3=Tinto |first3=Winston F. |title=Review of β-carboline Alkaloids from the Genus Aspidosperma |journal=Natural Product Communications |date=January 2015 |volume=10 |issue=1 |pages=1934578X1501000 |doi=10.1177/1934578X1501000139|doi-access=free }}{{open access}}
Category:Alkaloids found in Apocynaceae
{{alkaloid-stub}}