:LGD-3303
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 414168979
| IUPAC_name = 9-chloro-2-ethyl-1-methyl-3-(2,2,2-trifluoroethyl)-3H,6H,7H-pyrrolo[3,2-f]quinolin-7-one
| image = LGD-3303.svg
| width = 225px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = By mouth
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 917891-35-1
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 25195253
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7N4E1X2RJM
| ChemSpiderID = 35143239
| synonyms =
| C=16 | H=14 | Cl=1 | F=3 | N=2 | O=1
| SMILES = CCC1=C(C2=C(N1CC(F)(F)F)C=CC3=C2C(=CC(=O)N3)Cl)C
| StdInChI = 1S/C16H14ClF3N2O/c1-3-11-8(2)14-12(22(11)7-16(18,19)20)5-4-10-15(14)9(17)6-13(23)21-10/h4-6H,3,7H2,1-2H3,(H,21,23)
| StdInChIKey = OMXGOGXEWUCLFI-UHFFFAOYSA-N
}}
LGD-3303 is a drug which acts as a selective androgen receptor modulator (SARM), with good oral bioavailability. It is a selective agonist for the androgen receptor, producing functional selectivity with effective dissociation of anabolic and androgenic effects, acting as a partial agonist for androgenic effects, but a full agonist for anabolic effects.{{cite journal | vauthors = Vajda EG, López FJ, Rix P, Hill R, Chen Y, Lee KJ, O'Brien Z, Chang WY, Meglasson MD, Lee YH | display-authors = 6 | title = Pharmacokinetics and pharmacodynamics of LGD-3303 [9-chloro-2-ethyl-1-methyl-3-(2,2,2-trifluoroethyl)-3H-pyrrolo-[3,2-f]quinolin-7(6H)-one], an orally available nonsteroidal-selective androgen receptor modulator | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 328 | issue = 2 | pages = 663–70 | date = February 2009 | pmid = 19017848 | doi = 10.1124/jpet.108.146811 | s2cid = 22107491 | url = http://jpet.aspetjournals.org/content/328/2/663.full | url-access = subscription }} It has been investigated as a possible treatment for osteoporosis, and was shown in animal studies to enhance the effectiveness of a bisphosphonate drug.{{cite journal | vauthors = Vajda EG, Hogue A, Griffiths KN, Chang WY, Burnett K, Chen Y, Marschke K, Mais DE, Pedram B, Shen Y, van Oeveren A, Zhi L, López FJ, Meglasson MD | display-authors = 6 | title = Combination treatment with a selective androgen receptor modulator q(SARM) and a bisphosphonate has additive effects in osteopenic female rats | journal = Journal of Bone and Mineral Research | volume = 24 | issue = 2 | pages = 231–40 | date = February 2009 | pmid = 18847323 | doi = 10.1359/jbmr.081007 | s2cid = 21995180 | doi-access = free }}
References
{{Reflist}}
{{Androgen receptor modulators}}
Category:Selective androgen receptor modulators
Category:Trifluoromethyl compounds
{{genito-urinary-drug-stub}}