:LPK-26

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 451562149

| IUPAC_name = 2-(3,4-dichlorophenyl)-N-[(2S)-1-(2,5-dihydropyrrol-1-yl)-3-methylbutan-2-yl]-N-methylacetamide

| image = LPK-26 Structure.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 492451-07-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = HTE2K3D35Y

| ATC_prefix =

| ATC_suffix =

| PubChem = 10043746

| IUPHAR_ligand =

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 8219310

| C=18 | H=24 | Cl=2 | N=2 | O=1

| smiles = CC(C)[C@@H](CN1CC=CC1)N(C)C(=O)CC2=CC(=C(C=C2)Cl)Cl

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C18H24Cl2N2O/c1-13(2)17(12-22-8-4-5-9-22)21(3)18(23)11-14-6-7-15(19)16(20)10-14/h4-7,10,13,17H,8-9,11-12H2,1-3H3/t17-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QFAIAMMFKKYCTL-QGZVFWFLSA-N

}}

LPK-26 is a potent and selective κ-opioid agonist, and has analgesic effects.{{cite journal |vauthors=Tao YM, Li QL, Zhang CF, Xu XJ, Chen J, Ju YW, Chi ZQ, Long YQ, Liu JG |title=LPK-26, a novel kappa-opioid receptor agonist with potent antinociceptive effects and low dependence potential |journal=European Journal of Pharmacology |volume=584 |issue=2–3 |pages=306–11 |date=April 2008 |pmid=18353307 |doi=10.1016/j.ejphar.2008.02.028 }}

See also

References