:LY-293284

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 451561741

| IUPAC_name = (4R)-6-acetyl-4-(di-n-propylamino)-1,3,4,5-tetrahydrobenz[c,d]indole

| image = LY293284_structure.png

| width = 200

| tradename =

| legal_status =

| class = Serotonin 5-HT_1A receptor agonist; Simplified/partial LSD analogue

| IUPHAR_ligand = 19

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 141318-62-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 92MME29XHM

| PubChem = 132345

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID = 116875

| synonyms = LY293284

| C=19 | H=26 | N=2 | O=1

| smiles = CCCN(CCC)[C@H]1CC2=CNC3=C2C(=C(C=C3)C(=O)C)C1

| StdInChI = 1S/C19H26N2O/c1-4-8-21(9-5-2)15-10-14-12-20-18-7-6-16(13(3)22)17(11-15)19(14)18/h6-7,12,15,20H,4-5,8-11H2,1-3H3/t15-/m0/s1

| StdInChIKey = CKYZLYQSDNLGPT-HNNXBMFYSA-N

}}

LY-293284 is a research chemical developed by the pharmaceutical company Eli Lilly and used for scientific studies. It acts as a potent and selective 5-HT_1A receptor full agonist. It was derived through structural simplification of the ergoline based psychedelic LSD,{{cite journal |vauthors=Monte AP, Marona-Lewicka D, Lewis MM, Mailman RB, Wainscott DB, Nelson DL, Nichols DE |title=Substituted naphthofurans as hallucinogenic phenethylamine-ergoline hybrid molecules with unexpected muscarinic antagonist activity |journal=Journal of Medicinal Chemistry |volume=41 |issue=12 |pages=2134–45 |date=June 1998 |pmid=9622555 |doi=10.1021/jm980076u }} but is far more selective for 5-HT_1A with over 1000× selectivity over other serotonin receptor subtypes and other targets.{{cite journal |vauthors=Foreman MM, Fuller RW, Rasmussen K, Nelson DL, Calligaro DO, Zhang L, Barrett JE, Booher RN, Paget CJ, Flaugh ME |title=Pharmacological characterization of LY293284: A 5-HT1A receptor agonist with high potency and selectivity |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=270 |issue=3 |pages=1270–81 |date=September 1994 |pmid=7523657 }} It has anxiogenic effects in animal studies.{{cite journal |vauthors=Cao BJ, Rodgers RJ |title=Comparative effects of novel 5-HT1A receptor ligands, LY293284, LY315712 and LY297996, on plus-maze anxiety in mice |journal=Psychopharmacology |volume=139 |issue=3 |pages=185–94 |date=October 1998 |pmid=9784072 |doi= 10.1007/s002130050703|s2cid=9466299 }}