:Leucopeonidin

{{chembox

| Watchedfields = changed

| verifiedrevid = 423447281

| Name = Leucopeonidin

| ImageFile = Leucopeonidin.svg

| ImageSize = 200px

| IUPACName = 2-(4-Hydroxy-3-methoxyphenyl)chromenylium-3,5,7-triol

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 20408-92-8

| ChemSpiderID = 57438550

| PubChem = 57459454

| SMILES = OC1C(O)C2C(C=C(O)C=C2O)OC1c(cc3OC)ccc3O

| StdInChI=1S/C16H18O7/c1-22-11-4-7(2-3-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,12-21H,1H3

| StdInChIKey = ZZNPEGJLMUWYNN-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=16|H=18|O=7

| Appearance =

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Leucopeonidin is a leucoanthocyanidin.

A leucopeonidin glycoside is found in the bark of Ficus bengalensis.{{Cite journal | pmid = 8500813| year = 1993| last1 = Cherian| first1 = S| title = Antidiabetic effects of a glycoside of leucopelargonidin isolated from Ficus bengalensis Linn| journal = Indian Journal of Experimental Biology| volume = 31| issue = 1| pages = 26–9| last2 = Augusti| first2 = K. T}}