:Levopropoxyphene

{{cs1 config|name-list-style=vanc}}

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 462091242

| ImageFile = Levopropoxyphene structure.svg

| ImageSize = 200px

| PIN = (2R,3S)-4-(Dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl propanoate

| OtherNames =

| Section1={{Chembox Identifiers

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = U75VZ9PK1J

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1213351

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 21234163

| SMILES = CCC(=O)OC(Cc1ccccc1)(c2ccccc2)C(C)CN(C)C

| InChI = 1/C22H29NO2/c1-5-21(24)25-22(18(2)17-23(3)4,20-14-10-7-11-15-20)16-19-12-8-6-9-13-19/h6-15,18H,5,16-17H2,1-4H3/t18-,22-/m1/s1

| InChIKey = XLMALTXPSGQGBX-XMSQKQJNBJ

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C22H29NO2/c1-5-21(24)25-22(18(2)17-23(3)4,20-14-10-7-11-15-20)16-19-12-8-6-9-13-19/h6-15,18H,5,16-17H2,1-4H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = XLMALTXPSGQGBX-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 2338-37-6

| PubChem = 200742

| SMILES2 = O=C(O[C@](c1ccccc1)(Cc2ccccc2)[C@@H](C)CN(C)C)CC

}}

|Section2={{Chembox Properties

| Formula = | C=22 | H=29 | N=1 | O=2

| MolarMass = 339.471

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Levopropoxyphene is an antitussive. It is an optical isomer of dextropropoxyphene. The racemic mixture is called propoxyphene. Only the dextro-isomer (dextropropoxyphene) has an analgesic effect; the levo-isomer appears to exert only an antitussive effect. It was formerly marketed in the U.S. by Eli Lilly under the tradename Novrad (a reversal of Darvon) as an antitussive.Reference.MD: [http://www.reference.md/files/C084/mC084813.html Propoxyphene napsylate]{{cite book|url=http://irs.ub.rug.nl/ppn/242581676|publisher=Rijksuniversiteit Groningen|title=Enantioselective biocatalytic conversions of epoxides|author=Lutje Spelberg|author2=Jeffrey Harald |year=2003}} Unlike many antitussives, it binds poorly to the sigma-1 receptor.{{cite journal | vauthors = Klein M, Musacchio JM | title = Dextromethorphan binding sites in the guinea pig brain. | journal = Cellular and Molecular Neurobiology | volume = 8 | issue = 2 | pages = 149–156 | date = October 10, 1988 | doi = 10.1007/BF00711241 | pmid = 3044591 | s2cid = 33844132 | pmc = 11567495 }}