:Lithium stearate
{{Chembox
| Name = Lithium stearate
| ImageFile =Lithium stearate.svg
| ImageSize =250px
| PIN = Lithium octadecanoate
| OtherNames =
|Section1={{Chembox Identifiers
| Abbreviations =
| CASNo =4485-12-5
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = P31MC94P70
| EINECS = 224-772-5
| PubChem = 20569
| ChemSpiderID = 19369
| SMILES = [Li+].[O-]C(=O)CCCCCCCCCCCCCCCCC
| InChI = InChI=1S/C18H36O2.Li/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-17H2,1H3,(H,19,20);/q;+1/p-1
| RTECS =
| MeSHName =
| ChEBI =
| KEGG =
}}
|Section2={{Chembox Properties
| C=18 | H=35 | Li=1 | O=2
| Appearance =
| Density =
| MeltingPt =
| MeltingPt_notes =
| BoilingPt =
| BoilingPt_notes =
| Solubility =
| SolubleOther =
| Solvent =
| LogP =
| VaporPressure =
| HenryConstant =
| AtmosphericOHRateConstant =
| pKa =
| pKb =
}}
|Section3={{Chembox Structure
| CrystalStruct =
| Coordination =
| MolShape =
}}
|Section4={{Chembox Thermochemistry
| DeltaHf =
| DeltaHc =
| Entropy =
| HeatCapacity =
}}
|Section5={{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| Pregnancy_category =
| Pregnancy_AU =
| Pregnancy_US =
}}
|Section6={{Chembox Explosive
| ShockSens =
| FrictionSens =
| DetonationV =
| REFactor =
}}
|Section7={{Chembox Hazards
| ExternalSDS =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-S =
| FlashPt =
| AutoignitionPt =
| ExploLimits =
| LD50 =
| PEL =
}}
|Section8={{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunction =
| OtherFunction_label =
| OtherCompounds =
}}
}}
Lithium stearate is a chemical compound with the formula LiO2C(CH2)16CH3. It is formally classified as a soap (a salt of a fatty acid). Lithium stearate is a white soft solid, prepared by the reaction of lithium hydroxide and stearic acid.
Lithium stearate and lithium 12-hydroxystearate are lithium soaps, and are components of lithium greases and release agents.{{Ullmann|doi=10.1002/14356007.a16_361|title=Metallic Soaps|year=2001|last1=Nora|first1=Angelo|last2=Szczepanek|first2=Alfred|last3=Koenen|first3=Gunther|isbn=3527306730}}
References
{{reflist}}
External links
- [http://www.chemicalland21.com/industrialchem/inorganic/LITHIUM%20STEARATE.htm chemical land]
{{Lithium compounds}}
{{Stearates}}