:Lobelanine

{{Chembox

| ImageFile = Lobelanine.svg

| ImageSize = 200px

| ImageAlt =

| PIN = 2,2′-[(2R,6S)-1-Methylpiperidine-2,6-diyl]bis(1-phenylethan-1-one)

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 579-21-5

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4XWB84090T

| PubChem = 442647

| InChI=1S/C22H25NO2/c1-23-19(15-21(24)17-9-4-2-5-10-17)13-8-14-20(23)16-22(25)18-11-6-3-7-12-18/h2-7,9-12,19-20H,8,13-16H2,1H3/t19-,20+

| InChIKey= IDEMKXUAULKYJV-BGYRXZFFSA-N

| SMILES = CN1[C@H](CCC[C@H]1CC(=O)C2=CC=CC=C2)CC(=O)C3=CC=CC=C3

| ChemSpiderID = 391009

| KEGG = C10157}}

|Section2={{Chembox Properties

| C=22 | H=25 | N=1 | O=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Lobelanine is a chemical precursor in the biosynthesis of lobeline.{{cite journal | url = http://pubs.rsc.org/en/content/articlelanding/1971/j3/j39710002889 | title = The biosynthesis of Lobelia alkaloids. Part II. The role of lobelanine in the biosynthesis of lobeline | journal = Journal of the Chemical Society C: Organic | pages = 2889–2890 | doi = 10.1039/J39710002889 | year = 1971 | last1 = O'Donovan | first1 = D. G. | last2 = Forde | first2 = T. | url-access = subscription }}