:MADAM-6

{{chembox

| ImageFile = Madam-6.png

| ImageSize = 200px

| PIN = N-Methyl-1-(6-methyl-2H-1,3-benzodioxol-5-yl)propan-2-amine

| OtherNames = 6-Methyl-MDMA

|Section1={{Chembox Identifiers

| CASNo = 207740-46-3

| UNII = W3H6GHJ73C

| ChemSpiderID=21106340

| PubChem = 44719578

| DTXSID = DTXSID80660368

| SMILES = C1(=CC2=C(C=C1CC(C)NC)OCO2)C

| StdInChI=1S/C12H17NO2/c1-8-4-11-12(15-7-14-11)6-10(8)5-9(2)13-3/h4,6,9,13H,5,7H2,1-3H3

| StdInChIKey = CRQPDNIUPWXPNK-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=12

| H=17

| N=1

| O=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

MADAM-6, or 2, N-dimethyl-4,5-methylenedioxyamphetamine, is a lesser-known recreational drug of the methamphetamine class, similar in structure to MDMA (ecstasy).{{Cite journal | doi = 10.1007/BF02349410| title = N-[11C]methyl-3,4-methylenedioxyamphetamine (Ecstasy) and 2-methyl-N-[11C]methyl-4,5-methylenedioxyamphetamine: Synthesis and biodistribution studies| journal = Journal of Radioanalytical and Nuclear Chemistry| volume = 240| issue = 2| pages = 535| year = 1999| last1 = Patt| first1 = M| last2 = Gündisch| first2 = D| last3 = Wüllner| first3 = U| last4 = Blocher| first4 = A| last5 = Kovar| first5 = K. -A| last6 = Machulla| first6 = H. -J| s2cid = 96272983}} MADAM-6 was first synthesized by Alexander Shulgin.[http://www.erowid.org/library/books_online/pihkal/pihkal098.shtml MADAM-6 entry in PiHKAL] In Shulgin's book PiHKAL, the minimum dosage is listed as greater than 280 mg, and the duration is unknown. MADAM-6 produces few to no effects and Shulgin describes it as "not active". Very little data exists about the pharmacological properties, metabolism, and toxicity of MADAM-6.

MADAM-6 has been studied for its potential antiparkinsonian effects.{{cite patent |country= US|number=US2015025063 |status= patent|title=Antiparkinsonian Action Of Phenylisopropylamines |pubdate=2014-09-30 |gdate=2015-01-22 |invent1= Caron |invent2= Gainetdinov |invent3 = Sotnikova |url=https://pubchem.ncbi.nlm.nih.gov/patent/US2015025063}} However, no clinical trials suggest the drug is effective against Parkinson's disease.