:MMPIP

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 449871472

| IUPAC_name = 6-(4-methoxyphenyl)-5-methyl-3-pyridin-4-ylisoxazolo[4,5-c]pyridin-4(5H)-one

| image = MMPIP.png

| caption = Two-dimensional molecular structure

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 479077-02-6

| ATC_prefix =

| ATC_suffix =

| PubChem = 9945530

| ChemSpiderID = 8121142

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL = 593489

| IUPHAR_ligand = 3341

| C = 19

| H = 15

| N = 3

| O = 3

| smiles = COc3ccc(cc3)C2CC(C1C(=O)N2C)ON=C1c4ccncc4

}}

MMPIP is a drug used in scientific research that acts as a selective antagonist for the metabotropic glutamate receptor subtype mGluR₇.{{cite journal |vauthors=Suzuki G, Tsukamoto N, Fushiki H, Kawagishi A, Nakamura M, Kurihara H, Mitsuya M, Ohkubo M, Ohta H |title=In vitro pharmacological characterization of novel isoxazolopyridone derivatives as allosteric metabotropic glutamate receptor 7 antagonists |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=323 |issue=1 |pages=147–56 |date=October 2007 |pmid=17609420 |doi=10.1124/jpet.107.124701 |s2cid=10402176 }} This receptor subtype appears to be involved in the downstream response to cocaine in the brain.{{cite journal |vauthors=Li X, Li J, Peng XQ, Spiller K, Gardner EL, Xi ZX |title=Metabotropic glutamate receptor 7 modulates the rewarding effects of cocaine in rats: involvement of a ventral pallidal GABAergic mechanism |journal=Neuropsychopharmacology |volume=34 |issue=7 |pages=1783–96 |date=June 2009 |pmid=19158667 |doi=10.1038/npp.2008.236 |pmc=3739975 }}