:Mannitol hexanitrate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 412986143

| ImageFile=Nitromannite.png

| IUPACName=D-Mannitol hexanitrate

| SystematicName=(2R,3R,4R,5R)-Hexane-1,2,3,4,5,6-hexayl hexanitrate

| OtherNames=Mannitol hexanitrate
Nitromannite
Nitromannitol
Nitranitol
Mannitrin

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=15825-70-4

| PubChem=61818

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2104740

| EINECS = 239-924-6

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 99AU28W1G9

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 55696

| SMILES = C([C@H]([C@H]([C@@H]([C@@H](CO[N+](=O)[O-])O[N+](=O)[O-])O[N+](=O)[O-])O[N+](=O)[O-])O[N+](=O)[O-])O[N+](=O)[O-]

| InChI = 1/C6H8N6O18/c13-7(14)25-1-3(27-9(17)18)5(29-11(21)22)6(30-12(23)24)4(28-10(19)20)2-26-8(15)16/h3-6H,1-2H2/t3-,4-,5-,6-/m1/s1

| InChIKey = DGMJZELBSFOPHH-KVTDHHQDBN

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C6H8N6O18/c13-7(14)25-1-3(27-9(17)18)5(29-11(21)22)6(30-12(23)24)4(28-10(19)20)2-26-8(15)16/h3-6H,1-2H2/t3-,4-,5-,6-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = DGMJZELBSFOPHH-KVTDHHQDSA-N

}}

|Section2={{Chembox Properties

| Formula=C₆H₈N₆O₁₈

| MolarMass=452.15 g/mol

| Appearance=

| Density=1.73 g/cm³

| MeltingPt={{convert|112|C|F K}}

| BoilingPt=

| Solubility=insoluble

}}

|Section3={{Chembox Explosive

| ShockSens= more sensitive than PETN, slightly below the line separating primary and secondary explosives

| FrictionSens= comparable to PETN

| DetonationV = 8260 m/s (@ 1.73 g/cm³)

| REFactor=1.70

}}

|Section4={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt=

}}

}}

Mannitol hexanitrate is a powerful explosive. Physically, it is a powdery solid at normal temperature ranges, with density of 1.73 g/cm³. The chemical name is hexanitromannitol and it is also known as nitromannite, MHN, and nitromannitol, and by the trademarks Nitranitol and Mannitrin. It is more stable than nitroglycerin, and it is used in detonators.

Mannitol hexanitrate is a secondary explosive formed by the nitration of mannitol, a sugar alcohol. The product is used in medicine as a vasodilator and as an explosive in blasting caps. Its sensitivity is high, particularly at high temperatures (> 75 °C) where it is slightly more sensitive than nitroglycerine. Nitromannite is a class B explosive.

The production of pure MHN is not a trivial task, since most preparations will yield a mixture of MHN and lower esters (pentanitrate and lower).{{Cite journal|last1=Künzel|first1=Martin|last2=Yan|first2=Qi-Long|last3=Šelešovský|first3=Jakub|last4=Zeman|first4=Svatopluk|last5=Matyáš|first5=Robert|date=2014-01-01|title=Thermal behavior and decomposition kinetics of ETN and its mixtures with PETN and RDX|journal=Journal of Thermal Analysis and Calorimetry|language=en|volume=115|issue=1|pages=289–299|doi=10.1007/s10973-013-3265-2|s2cid=95382460|issn=1388-6150}}