:Methanophenazine

{{Chembox

| ImageFile = Methanophenazine.svg

| ImageSize = 250px

| IUPACName = 2-{[(3S,6E,10E,14E)-3,7,11,15,19-pentamethylicosa-6,10,14,18-tetraen-1-yl]oxy}phenazine

| OtherNames = (−)-(S)-Methanophenazine

|Section1={{Chembox Identifiers

| CASNo = 295327-13-8

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3458PQ9Q64

| PubChem = 5281992

| ChemSpiderID = 4445251

| SMILES = C[C@@H](CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/C)CCOC1=CC2=NC3=CC=CC=C3N=C2C=C1

| InChI = InChI=1S/C37H50N2O/c1-28(2)13-9-14-29(3)15-10-16-30(4)17-11-18-31(5)19-12-20-32(6)25-26-40-33-23-24-36-37(27-33)39-35-22-8-7-21-34(35)38-36/h7-8,13,15,17,19,21-24,27,32H,9-12,14,16,18,20,25-26H2,1-6H3/b29-15+,30-17+,31-19+

}}

|Section2={{Chembox Properties

| C=37 | H=50 | N=2 | O=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Methanophenazine, a phenazine derivative, is a strongly hydrophobic redox-active cofactor with a role in electron transport in some methanogens.{{cite journal |author1=Beifuss, Uwe |author2=Tietze, Mario |author3=Baumer, Sebastian |author4=Deppenmeier, Uwe | title = Methanophenazine: structure, total synthesis, and function of a new cofactor from methanogenic Archaea | journal = Angewandte Chemie International Edition | year = 2000 | volume = 39 | issue = 14 | pages = 2470–2472 | doi = 10.1002/1521-3773(20000717)39:14<2470::AID-ANIE2470>3.0.CO;2-R | pmid=10941105}} This chromophore can be purified from membranes of methanogenic archaea such as Methanosarcina mazei. The enzyme methanosarcina-phenazine hydrogenase (EC 1.12.98.3) has the name methanophenazine hydrogenase as a synonym.