:Methyl phenkapton

{{more citations needed|date=August 2022}}

{{Chembox

| ImageFile = Methyl phenkapton.svg

| ImageSize = 200px

| PIN = S-{[(2,6-Dichlorophenyl)sulfanyl]methyl} O,O-dimethyl phosphorodithioate

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 3735-23-7

| CASNo_Ref = {{Cascite|changed|CAS}}

| PubChem = 62519

| ChemSpiderID = 56293

| UNNumber = 2783

| UNII = KZQ8324E26

| SMILES = Clc1ccc(Cl)cc1SCSP(=S)(OC)OC

| InChI = 1/C9H11Cl2O2PS3/c1-12-14(15,13-2)17-6-16-9-5-7(10)3-4-8(9)11/h3-5H,6H2,1-2H3

| InChIKey = IHCHKPCNDMQWGF-UHFFFAOYAL

| StdInChI = 1S/C9H11Cl2O2PS3/c1-12-14(15,13-2)17-6-16-9-5-7(10)3-4-8(9)11/h3-5H,6H2,1-2H3

| StdInChIKey = IHCHKPCNDMQWGF-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=9 | H=11 | Cl=2 | O=2 | P=1 | S=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Methyl phenkapton is an organophosphorus compound. It is highly toxic.{{Cite web |title=METHYL PHENKAPTON {{!}} CAMEO Chemicals {{!}} NOAA |url=https://cameochemicals.noaa.gov/chemical/5070 |url-status=live |archive-url=https://web.archive.org/web/20220820161646/https://cameochemicals.noaa.gov/chemical/5070 |archive-date=2022-08-20 |access-date=2022-08-20 |website=cameochemicals.noaa.gov |publisher=United States Government}}{{cite journal | vauthors = Zhao S, Xu W, Zhang W, Wu H, Guang C, Mu W | title = In-depth biochemical identification of a novel methyl parathion hydrolase from Azohydromonas australica and its high effectiveness in the degradation of various organophosphorus pesticides | journal = Bioresource Technology | volume = 323 | pages = 124641 | date = March 2021 | pmid = 33429316 | doi = 10.1016/j.biortech.2020.124641 | bibcode = 2021BiTec.32324641Z | s2cid = 231585106 }}