:Methylenedioxymethoxyethylamphetamine
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 424728565
| ImageFile = MDMEOET.svg
| ImageSize = 200px
| PIN = 1-(2H-1,3-Benzodioxol-5-yl)-N-(2-methoxyethyl)propan-2-amine
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 74698-44-5
| UNII = YPA4B5U3U8
| PubChem = 44719584
| DTXSID = DTXSID10660371
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 21106334
| SMILES = CC(Cc1ccc2c(c1)OCO2)NCCOC
| InChI = 1/C13H19NO3/c1-10(14-5-6-15-2)7-11-3-4-12-13(8-11)17-9-16-12/h3-4,8,10,14H,5-7,9H2,1-2H3
| InChIKey = LOZJEWOZOKSOKA-UHFFFAOYAB
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C13H19NO3/c1-10(14-5-6-15-2)7-11-3-4-12-13(8-11)17-9-16-12/h3-4,8,10,14H,5-7,9H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = LOZJEWOZOKSOKA-UHFFFAOYSA-N}}
|Section2={{Chembox Properties
| Formula = C13H19NO3
| MolarMass = 237.295 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
MDMEOET, also known as 3,4-methylenedioxy-N-methoxyethylamphetamine, is a lesser-known psychedelic drug and a substituted amphetamine. It is also the N-methoxyethyl analogue of MDA. MDMEOET was first synthesized by Alexander Shulgin. In his book PiHKAL (Phenethylamines i Have Known And Loved), the minimum dosage is listed as 180 mg. MDMEOET produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MDMEOET.
Legality
=United Kingdom=
This substance is a Class A drug in the Drugs controlled by the UK Misuse of Drugs Act.{{cite web | title = UK Misuse of Drugs act 2001 Amendment summary | url = http://isomerdesign.com/Cdsa/scheduleUK.php?schedule=1&ion=30&structure=C | accessdate = 12 March 2014 | publisher = Isomer Design | archive-date = 22 October 2017 | archive-url = https://web.archive.org/web/20171022085110/http://isomerdesign.com/Cdsa/scheduleUK.php?schedule=1&ion=30&structure=C | url-status = dead }}
See also
References
{{Reflist}}
External links
- [http://www.erowid.org/library/books_online/pihkal/pihkal112.shtml MDMEOET entry in PiHKAL]
- [http://pihkal.info/read.php?domain=pk&id=112 MDMEOET entry in PiHKAL • info]
{{Phenethylamines}}
Category:Methylenedioxyphenethylamines
Category:Substituted amphetamines
{{Psychoactive-stub}}