:Methyllinderone
{{Chembox
| Name =
| ImageFile = Methyllinderone.svg
| ImageAlt =
| ImageCaption =
| IUPACName = 4,5-dimethoxy-2-[(2E)-1-methoxy-3-phenylprop-2-enylidene]cyclopent-4-ene-1,3-dione
| SystematicName =
| OtherNames = Methylliderone
|Section1={{Chembox Identifiers
| Abbreviations =
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 3984-73-4
| CASNo1_Ref = {{cascite|correct|CAS}}
| CASNo1 = 2699712-20-2
| CASNo1_Comment = (non-specific)
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = YYE85YM58K
| PubChem = 10086155
| PubChem_Comment =
| PubChem5 =
| PubChem5_Comment =
| PubChemOther =
| ChemSpiderID = 8261692
| ChemSpiderID_Comment =
| ChemSpiderID5 =
| ChemSpiderIDOther =
| EINECS =
| EC_number =
| UNNumber =
| DrugBank =
| KEGG =
| MeSHName =
| ChEBI =
| RTECS =
| SMILES = COC1=C(C(=O)C(=C(/C=C/C2=CC=CC=C2)OC)C1=O)OC
| InChI =
| Beilstein =
| Gmelin =
| 3DMet = }}
|Section2={{Chembox Properties
| C=17 | H=16 | O=5
| MolarMass =
| Appearance =
| Density =
| MeltingPt =
| MeltingPt_notes =
| BoilingPt =
| BoilingPt_notes =
| LogP =
| VaporPressure =
| HenryConstant =
| AtmosphericOHRateConstant =
| pKa =
| pKb =
| Solubility =
| SolubleOther =
| Solvent = }}
|Section3={{Chembox Structure
| CrystalStruct =
| Coordination =
| MolShape = }}
|Section4={{Chembox Thermochemistry
| DeltaHc =
| DeltaHf =
| Entropy =
| HeatCapacity = }}
|Section5={{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| Pregnancy_category =
| Pregnancy_AU =
| Pregnancy_US = }}
|Section6={{Chembox Explosive
| ShockSens =
| FrictionSens =
| DetonationV =
| REFactor = }}
|Section7={{Chembox Hazards
| ExternalSDS =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-S =
| FlashPt =
| AutoignitionPt =
| ExploLimits =
| LD50 =
| PEL = }}
|Section8={{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunction =
| OtherFunction_label =
| OtherCompounds = }}
}}
Methyllinderone is a bio-active isolate of Lindera lucida.A dihydrochalcone from Lindera lucida. Yuan-Wah Leong, Leslie J. Harrison, Graham J. Bennett, Azizol A. Kadir and Joseph D. Connolly, Phytochemistry, Volume 47, Issue 5, March 1998, Pp. 891-894, {{doi|10.1016/S0031-9422(97)00947-3}}