:Moramide intermediate

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 3-Methyl-4-morpholin-4-yl-2,2-diphenylbutanoic acid

| image = Moramide-intermediate.svg

| image_class = skin-invert-image

| width = 160

| tradename = β-Methyl-α,α-diphenyl-4-morpholinebutanoic acid

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU = S9

| legal_BR = A1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA =

| legal_UK =

| legal_US = Schedule II

| legal_UN = N I

| legal_DE = Anlage II

| routes_of_administration = N/A

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 3626-55-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4O5ZQW8AMM

| ATC_prefix = none

| ATC_suffix =

| PubChem = 567581

| DrugBank =

| KEGG = C22688

| ChemSpiderID = 493453

| C=21 | H=25 | N=1 | O=3

| synonyms = 4-Morpholinebutanoic acid, β-methyl-α,α-diphenyl-, moramide intermediate

| smiles = O=C(O)C(c1ccccc1)(c2ccccc2)C(C)CN3CCOCC3

| StdInChI = 1S/C21H25NO3/c1-17(16-22-12-14-25-15-13-22)21(20(23)24,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,17H,12-16H2,1H3,(H,23,24)

| StdInChIKey = AWLNVHVUYACOMZ-UHFFFAOYSA-N

}}

Moramide intermediate (β-Methyl-α,α-diphenyl-4-morpholinebutanoic acid, on INCB Yellow List as 2-methyl-3-morpholino-1,1-diphenylpropane carboxylic acid) is a moramide precursor scheduled by UN Single Convention on Narcotic Drugs.

In the United States, moramide intermediate is designated as a Schedule II controlled substance,[http://www.deadiversion.usdoj.gov/schedules/orangebook/d_cs_drugcode.pdf Controlled Substances - by DEA Drug Code Number] and has an ACSCN of 9802. The 2014 annual manufacturing quota was nil.{{Cite web | url=http://www.deadiversion.usdoj.gov/quotas/conv_factor/index.html | title=DEA Diversion Control Division}}

In Australia, moramide intermediate is listed as a Schedule 9 (Prohibited Substance){{cite web |title=Therapeutic Goods (Poisons Standard—February 2024) Instrument 2024 |url=https://www.legislation.gov.au/F2024L00095/asmade/text |publisher=Federal Register of Legislation |access-date=18 June 2024 |date=23 January 2024}}

See also

References

{{Reflist|2}}

Category:Analgesics

Category:4-Morpholinyl compounds

{{organic-compound-stub}}