:Multistriatin
{{DISPLAYTITLE:Multistriatin}}
{{Chembox
| ImageFile = Multistriatin.svg
| ImageAlt =
| IUPACName = 5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane
| OtherNames = (1S,2R,4S,5R)-5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane
|Section1={{Chembox Identifiers
| CASNo = 59014-03-8
| ChemSpiderID1 = 474468
| UNII = CCJ8A99MHA
| PubChem = 13199930
| StdInChI=1S/C10H18O2/c1-4-10-8(3)5-7(2)9(12-10)6-11-10/h7-9H,4-6H2,1-3H3/t7-,8+,9-,10-/m1/s1
| StdInChIKey = YMBRJMLOGNZRFY-UTINFBMNSA-N
| SMILES = CCC12C(CC(C(O1)CO2)C)C
}}
|Section2={{Chembox Properties
| C=10 | H=18 | O=2
| Appearance =
| Density = 0.959 g/mL
| MeltingPt =
| BoilingPtC = 207.1
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPtC = 74.9
| AutoignitionPtC = }}
}}
Multistriatin is a pheromone of the elm bark beetle. It is a volatile compound released by a virgin female beetle when she has found a good source of food, such as an elm tree.{{cite book|last=Warren|first=Stuart|authorlink=Stuart Warren|title=Organic synthesis : the disconnection approach|year=1982}}
Potential applications
Males beetles, which carry the fungus which causes Dutch elm disease, are attracted to the pheromone. Hence multistriatin could be used to trap beetles and so prevent the spread of the disease.
Stereochemistry
The compound exists in several diastereomic forms, depending on the positions of the methyl groups.{{cite journal|last=Beck|first=Keith|title=Pheromone chemistry of the smaller European elm bark beetle|journal=Journal of Chemical Education|date=1 September 1978|volume=55|issue=9|pages=567|doi=10.1021/ed055p567|bibcode=1978JChEd..55..567B }} Only the natural stereoisomer, α-multistriatin, attracts the elm bark beetles.
File:Multistriatin stereochemistry.png{{clear-left}}