:Naphthol yellow S

{{Chembox

| Verifiedfields = changed

| verifiedrevid = 428747875

| Reference=[http://www.sigmaaldrich.com/catalog/ProductDetail.do?N4=70540|FLUKA&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC Naphthol Yellow S] at Sigma-Aldrich

| ImageFile = naphthol yellow S.png

| PIN = Disodium 5,7-dinitro-8-oxidonaphthalene-2-sulfonate

| OtherNames = Acid Yellow 1; Food Yellow 1; Sodium flavianate; Flavianic acid, sodium salt; C.I. 10316, Acid Yellow S, Amacid Yellow S, C.I. 10316, C.I. Acid Yellow 1, C.I. Food Yellow 1

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 846-70-8

| Beilstein = 3839220

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 87219

| ChemSpiderID = 2006234

| EINECS = 212-690-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 08F8S9O3I5

| PubChem = 2724063

| StdInChI=1S/C10H6N2O8S.2Na/c13-10-7-3-5(21(18,19)20)1-2-6(7)8(11(14)15)4-9(10)12(16)17;;/h1-4,13H,(H,18,19,20);;/q;2*+1/p-2

| StdInChIKey = CTIQLGJVGNGFEW-UHFFFAOYSA-L

| SMILES = C1=CC2=C(C=C1S(=O)(=O)[O-])C(=C(C=C2[N+](=O)[O-])[N+](=O)[O-])[O-].[Na+].[Na+]

}}

|Section2={{Chembox Properties

| C=10 | H=4 | N=2 | O=8 | S=1 | Na=2

| Appearance = yellow solid

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| GHS_ref={{cite web |title=Naphthol Yellow S |url=https://pubchem.ncbi.nlm.nih.gov/compound/2724063#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |language=en}}

| GHSPictograms = {{GHS07}}{{GHS08}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|317|373}}

| PPhrases = {{P-phrases|260|261|272|280|302+352|314|333+313|363|501}}

}}

}}

Naphthol yellow S is an organic compound that is a dye. It is a derivative of 1-naphthol. At one time it was a popular food colorant but it was delisted in 1959 in the U.S.{{cite journal|title=A Global Perspective on the History, Use, and Identification of Synthetic Food Dyes|author1=Sharma, Vinita|author2=McKone, Harold T.|author3=Markow, Peter G.|journal=Journal of Chemical Education|year=2011|volume=88|issue=1|pages=24–28|doi=10.1021/ed100545v|bibcode=2011JChEd..88...24S}}

References