:Naphthol yellow S
{{Chembox
| Verifiedfields = changed
| verifiedrevid = 428747875
| Reference=[http://www.sigmaaldrich.com/catalog/ProductDetail.do?N4=70540|FLUKA&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC Naphthol Yellow S] at Sigma-Aldrich
| ImageFile = naphthol yellow S.png
| PIN = Disodium 5,7-dinitro-8-oxidonaphthalene-2-sulfonate
| OtherNames = Acid Yellow 1; Food Yellow 1; Sodium flavianate; Flavianic acid, sodium salt; C.I. 10316, Acid Yellow S, Amacid Yellow S, C.I. 10316, C.I. Acid Yellow 1, C.I. Food Yellow 1
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 846-70-8
| Beilstein = 3839220
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 87219
| ChemSpiderID = 2006234
| EINECS = 212-690-2
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 08F8S9O3I5
| PubChem = 2724063
| StdInChI=1S/C10H6N2O8S.2Na/c13-10-7-3-5(21(18,19)20)1-2-6(7)8(11(14)15)4-9(10)12(16)17;;/h1-4,13H,(H,18,19,20);;/q;2*+1/p-2
| StdInChIKey = CTIQLGJVGNGFEW-UHFFFAOYSA-L
| SMILES = C1=CC2=C(C=C1S(=O)(=O)[O-])C(=C(C=C2[N+](=O)[O-])[N+](=O)[O-])[O-].[Na+].[Na+]
}}
|Section2={{Chembox Properties
| C=10 | H=4 | N=2 | O=8 | S=1 | Na=2
| Appearance = yellow solid
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
| GHSPictograms = {{GHS07}}{{GHS08}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|317|373}}
| PPhrases = {{P-phrases|260|261|272|280|302+352|314|333+313|363|501}}
}}
}}
Naphthol yellow S is an organic compound that is a dye. It is a derivative of 1-naphthol. At one time it was a popular food colorant but it was delisted in 1959 in the U.S.{{cite journal|title=A Global Perspective on the History, Use, and Identification of Synthetic Food Dyes|author1=Sharma, Vinita|author2=McKone, Harold T.|author3=Markow, Peter G.|journal=Journal of Chemical Education|year=2011|volume=88|issue=1|pages=24–28|doi=10.1021/ed100545v|bibcode=2011JChEd..88...24S}}