:Nardosinone

{{Chembox

| ImageFile = Nardosinone.svg

| ImageSize = 200px

| PIN = (3aR,9R,9aR,9bS)-1,1,9,9a-Tetramethyl-1,3a,4,7,8,9,9a,9b-octahydro-5H-naphtho[2,1-c][1,2]dioxol-5-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 23720-80-1

| CASNo_Ref = {{cascite|correct|}}

| PubChem = 168136

| ChemSpiderID = 147074

| SMILES = O=C2/C1=C/CC[C@@H](C)[C@@]1([C@@H]3C(OO[C@@H]3C2)(C)C)C

| InChI = 1/C15H22O3/c1-9-6-5-7-10-11(16)8-12-13(15(9,10)4)14(2,3)18-17-12/h7,9,12-13H,5-6,8H2,1-4H3/t9-,12-,13+,15+/m1/s1

| InChIKey = KXGHHSIMRWPVQM-JWFUOXDNBH

| StdInChI = 1S/C15H22O3/c1-9-6-5-7-10-11(16)8-12-13(15(9,10)4)14(2,3)18-17-12/h7,9,12-13H,5-6,8H2,1-4H3/t9-,12-,13+,15+/m1/s1

| StdInChIKey = KXGHHSIMRWPVQM-JWFUOXDNSA-N

}}

|Section2={{Chembox Properties

| C=15 | H=22 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Nardosinone is a sesquiterpene and chemical constituent of Nardostachys jatamansi.{{cite journal |vauthors=Schulte KE, Glauch G, Rücker G | title = Nardosinon, ein neuer Inhaltsstoff von Nardostachys chinensis Batalin | language = German |trans-title=Nardosinone, a new constituent of Nardostachys chinensis Batalin | journal = Tetrahedron Letters | year = 1965 | volume = 6 | issue = 35 | pages = 3083–3084 | pmid = 5828044 | doi = 10.1016/S0040-4039(01)89226-1 }} In in vitro studies, the compound has demonstrated concentration-dependent enhancement of bucladesine and staurosporine-induced neurite outgrowth.{{cite journal |vauthors=Li P, Matsunaga K, Yamakuni T, Ohizumi Y | title = Nardosinone, the first enhancer of neurite outgrowth-promoting activity of staurosporine and dibutyryl cyclic AMP in PC12D cells | journal = Developmental Brain Research | year = 2003 | volume = 145 | issue = 2 | pages = 177–183 | pmid = 14604758 | doi = 10.1016/S0165-3806(03)00239-6 }} Nardosinone has similarly been demonstrated to enhance NGF-mediated neurite outgrowth and synaptogenesis from PC12D cells.{{cite journal |vauthors=Li P, Matsunaga K, Yamamoto K, Yoshikawa R, Kawashima K, Ohizumi Y | title = Nardosinone, a novel enhancer of nerve growth factor in neurite outgrowth from PC12D cells | journal = Neuroscience Letters | year = 1999 | volume = 273 | issue = 1 | pages = 53–56 | pmid = 10505650 | doi = 10.1016/S0304-3940(99)00629-1 | s2cid = 19913929 }}

Additionally, nardosinone has demonstrated cytotoxic activity against cultured P-388 lymphocytic leukemia cells.{{cite journal |vauthors=Itokawa H, Masuyama K, Morita H, Takeya K | title = Cytotoxic sesquiterpenes from Nardostachys chinensis |journal = Chemical & Pharmaceutical Bulletin | year = 1993 | volume = 41 | issue = 6 | pages = 1183–1184 | pmid = 8370115 | doi = 10.1248/cpb.41.1183 | doi-access = free }}

References