:Neokuguaglucoside
{{Chembox
| Watchedfields = changed
| verifiedrevid = 424679132
| ImageFile = Neokuguaglucoside.svg
| ImageSize = 200px
| ImageAlt =
| IUPACName = 6-(hydroxymethyl)-3-(2-methylprop-1-enyl)-2-[(1S)-1-[(1R,4S,5S,8R,9R,12S,13S,16S)-5,9,17,17-tetramethyl-16-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-18-oxapentacyclo[10.5.2.01,13.04,12.05,9]nonadec-2-en-8-yl]ethyl]-2,3,4a,6,7,8-hexahydropyrano[2,3-b][1,4]dioxine-7,8,8a-triol
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo =
| PubChem = 57518367
| SMILES = CC1(C)[C@@H](O[C@]2([H])O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]2O)CC[C@]3([H])[C@]14C=C[C@]5([H])[C@@]3(CO4)CC[C@@]6(C)[C@@]5(C)CC[C@]6([H])[C@H](C)C7C(/C=C(C)/C)OC8C(C(O)C(O)C(CO)O8)(O)O7
| StdInChI=1S/C42H66O14/c1-20(2)16-23-33(56-42(50)34(49)30(46)25(18-44)54-36(42)53-23)21(3)22-10-12-39(7)26-11-13-41-27(40(26,19-51-41)15-14-38(22,39)6)8-9-28(37(41,4)5)55-35-32(48)31(47)29(45)24(17-43)52-35/h11,13,16,21-36,43-50H,8-10,12,14-15,17-19H2,1-7H3/t21-,22+,23?,24+,25?,26-,27-,28-,29+,30?,31+,32+,33?,34?,35-,36?,38+,39-,40-,41+,42?/m0/s1
| StdInChIKey = JPQWDHPCZFTMSQ-BLIMDOIWSA-N
}}
|Section2={{Chembox Properties
| C=42 | H=66 | O=14
| Appearance = White powder
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Neokuguaglucoside is a chemical compound with formula {{chem|C|42|H|66|O|14}}, isolated from the fruit of the bitter melon vine (Momordica charantia, called kǔguā in Chinese), where it occurs at 23 mg/35 kg. It is a triterpene glucoside with the cucurbitane skeleton. It is a white powder, soluble in methanol and butanol.{{cite journal | author = Jie-Qing Liu, Jian-Chao Chen, Cui-Fang Wang and Ming-Hua Qiu | year = 2010 | title = One new cucurbitane triterpenoid from the fruits of Momordica charantia | journal = European Journal of Chemistry | volume = 1 | issue = 4 |pages=294–296 | doi = 10.5155/eurjchem.1.4.294-296.131 | url = http://www.eurjchem.com/index.php/eurjchem/article/view/131| doi-access = free }}