:Netoglitazone

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 451556686

| IUPAC_name = 5-[(6-[(2-Fluorophenyl)methoxy]naphthalen-2-yl)methyl]-1,3-thiazolidine-2,4-dione

| image = Netoglitazone.svg

| width = 222

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 2707

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 161600-01-7

| ATC_prefix = None

| ATC_suffix =

| PubChem = 204109

| DrugBank = DB09199

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 176806

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = QOV2JZ647A

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D05150

| C=21 | H=16 | F=1 | N=1 | O=3 | S=1

| smiles = C1=CC=C(C(=C1)COC2=CC3=C(C=C2)C=C(C=C3)CC4C(=O)NC(=O)S4)F

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C21H16FNO3S/c22-18-4-2-1-3-16(18)12-26-17-8-7-14-9-13(5-6-15(14)11-17)10-19-20(24)23-21(25)27-19/h1-9,11,19H,10,12H2,(H,23,24,25)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = PKWDZWYVIHVNKS-UHFFFAOYSA-N

}}

Netoglitazone (also called MCC-555) is a hypoglycemic agent belonging to the thiazolidinedione group.{{cite journal | vauthors = Lazarenko OP, Rzonca SO, Suva LJ, Lecka-Czernik B | title = Netoglitazone is a PPAR-gamma ligand with selective effects on bone and fat | journal = Bone | volume = 38 | issue = 1 | pages = 74–84 | date = January 2006 | pmid = 16137931 | pmc = 1850100 | doi = 10.1016/j.bone.2005.07.008 }}