:Neurolenin B

{{More sources needed|date=June 2023}}

{{Chembox

| ImageFile = Neurolenin B.svg

| ImageSize = 150px

| ImageAlt =

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 67506-30-3

| CASNo_Ref = {{Cascite|changed|EPA}}

| ChEBI = 66621

| ChEMBL = 1173219

| PubChem = 49799795

| ChemSpiderID = 25059553

| SMILES = C[C@@H]/1C[C@@H]2[C@@H]([C@@H]([C@H]([C@](C(=O)/C=C1)(C)O)OC(=O)C)OC(=O)CC(C)C)C(=C)C(=O)O2

| StdInChI=1S/C22H30O8/c1-11(2)9-17(25)30-19-18-13(4)21(26)29-15(18)10-12(3)7-8-16(24)22(6,27)20(19)28-14(5)23/h7-8,11-12,15,18-20,27H,4,9-10H2,1-3,5-6H3/b8-7-/t12-,15+,18-,19-,20+,22+/m0/s1

| StdInChIKey = UVRIFAYGSSDVER-MBZNIOTRSA-N

}}

|Section2={{Chembox Properties

| C=22 | H=30 | O=8

| Formula =

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Neurolenin B is an antimalarial chemical isolated from Neurolaena lobata and Austroeupatorium inulifolium.{{Cite web |last=PubChem |title=Neurolenin B |url=https://pubchem.ncbi.nlm.nih.gov/compound/49799795 |access-date=2023-10-25 |website=pubchem.ncbi.nlm.nih.gov |language=en}}{{cite journal | pmid = 12116880 | date = 2002 | last1 = Blair | first1 = S. | last2 = Mesa | first2 = J. | last3 = Correa | first3 = A. | last4 = Carmona-Fonseca | first4 = J. | last5 = Granados | first5 = H. | last6 = Sáez | first6 = J. | title = Antimalarial activity of neurolenin B and derivates of Eupatorium inulaefolium (Asteraceae) | journal = Die Pharmazie | volume = 57 | issue = 6 | pages = 413–415 }}