:Nicotinyl methylamide

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 428752125

| ImageFile=Methylnicotinamide.png

| ImageSize=150px

| ImageAlt=Skeletal formula of nicotinyl methylamide

| ImageFile1=Nicotinyl methylamide 3D ball.png

| ImageSize1=180

| ImageAlt1=Ball-and-stick model of the nicotinyl methylamide molecule

| PIN=N-Methylpyridine-3-carboxamide

| OtherNames=N-Methylnicotinamide; N-Methylniacinamide

|Section1={{Chembox Identifiers

| Abbreviations=NAN{{Citation needed|date=January 2012}}

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=114-33-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = X3I82S5L8I

| PubChem=64950

| DrugBank = DB08840

| SMILES=CNC(=O)C1=CN=CC=C1

| InChI = 1/C7H8N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-5H,1H3,(H,8,10)

| InChIKey = ZYVXHFWBYUDDBM-UHFFFAOYAC

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C7H8N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-5H,1H3,(H,8,10)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = ZYVXHFWBYUDDBM-UHFFFAOYSA-N

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 58476

| EINECS = 204-046-4

| MeSHName = C008472

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 64399

}}

|Section2={{Chembox Properties

| C=7 | H=8 | N=2 | O=1

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section7={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = A05

| ATCCode_suffix = AB01

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

}}

}}

Nicotinyl methylamide is an experimental drug with no approved indication.{{cite web | url = https://go.drugbank.com/drugs/DB08840 | title = N-methylnicotinamide | work = DrugBank }} It is also a metabolite of nicotinamide (vitamin B₃) and is found in urine.{{cite web | url = https://drugs.ncats.io/drug/X3I82S5L8I | title = Nicotinyl methylamide | work = Inxight Drugs | publisher = National Center for Advancing Translational Sciences }}