:Niperotidine

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444599209

| ImageFile = Niperotidine.svg

| ImageSize = 300

| PIN = (Z)-N¹-[(2H-1,3-Benzodioxol-5-yl)methyl]-N′¹-{2-[({5-[(dimethylamino)methyl]furan-2-yl}methyl)sulfanyl]ethyl}-2-nitroethene-1,1-diamine

| OtherNames =

| Section1 = {{Chembox Identifiers

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 12JBD7U72K

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 84845-75-0

| PubChem = 3033952

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07072

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1909284

| SMILES = CN(C)Cc1ccc(o1)CSCCN/C(=C\[N+](=O)[O-])NCc2cc3OCOc3cc2

| EINECS = 284-304-0

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 11644617

| InChI = 1/C20H28N4O5S/c1-23(2)11-16-4-5-17(29-16)13-30-8-7-21-20(12-24(25)26)22-10-15-3-6-18-19(9-15)28-14-27-18/h3-6,9,20-22H,7-8,10-14H2,1-2H3

| InChIKey = VZPXHGJTEAPNAA-UHFFFAOYAQ

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C20H28N4O5S/c1-23(2)11-16-4-5-17(29-16)13-30-8-7-21-20(12-24(25)26)22-10-15-3-6-18-19(9-15)28-14-27-18/h3-6,9,20-22H,7-8,10-14H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = VZPXHGJTEAPNAA-UHFFFAOYSA-N

| RTECS =

| MeSHName = C073716

}}

| Section2 = {{Chembox Properties

| C=20

| H=26

| N=4

| O=5

| S=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section6 = {{Chembox Pharmacology

| ATCCode_prefix = A02

| ATCCode_suffix = BA05

}}

|Section7 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Niperotidine is a histamine antagonist selective for the H₂ subtype. It was studied as a treatment for excessive gastric acidity,{{cite journal | pmid = 1983712| year = 1990| last1 = Palasciano| first1 = G| title = The effect of the H2-antagonist niperotidine on intragastric acidity in healthy subjects undergoing 24-hour pH-monitoring| journal = The Italian Journal of Gastroenterology| volume = 22| issue = 5| pages = 291–4| last2 = Maggi| first2 = V| last3 = Portincasa| first3 = P}} but withdrawn after human trials showed liver damage.{{cite journal | pmid = 9314138| year = 1997| last1 = Gasbarrini| first1 = G| title = Acute liver injury related to the use of niperotidine| journal = Journal of Hepatology| volume = 27| issue = 3| pages = 583–6| last2 = Gentiloni| first2 = N| last3 = Febbraro| first3 = S| last4 = Gasbarrini| first4 = A| last5 = Di Campli| first5 = C| last6 = Cesana| first6 = M| last7 = Miglio| first7 = F| last8 = Miglioli| first8 = M| last9 = Ghinelli| first9 = F| last10 = d'Ambrosi| first10 = A| last11 = Amoroso| first11 = P| last12 = Pacini| first12 = F| last13 = Salvadori| first13 = G| doi=10.1016/s0168-8278(97)80365-0}}