:O-2545

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 435602295

| IUPAC_name = (6aR,10aR)-6a,7,10,10a-Tetrahydro-3-[5-(1H-imidazol-1-yl)-1,1-dimethylpentyl]-6,6,9-trimethyl-6H-dibenzo[b,d]pyran-1-ol

| image = O-2545.svg

| image_class = skin-invert-image

| width = 240

| tradename =

| legal_status = Unscheduled

| routes_of_administration =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 874745-42-3

| PubChem =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 22938186

| C=26 | H=36 | N=2 | O=2

| smiles = CC1=CC[C@H]2[C@@](Oc3c(c(cc(c3)C(CCCCn4cncc4)(C)C)O)[C@@H]2C1)(C)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C26H36N2O2/c1-18-8-9-21-20(14-18)24-22(29)15-19(16-23(24)30-26(21,4)5)25(2,3)10-6-7-12-28-13-11-27-17-28/h8,11,13,15-17,20-21,29H,6-7,9-10,12,14H2,1-5H3/t20-,21-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = RZGSWWCABDVBGX-NHCUHLMSSA-N

}}

O-2545 is an analgesic cannabinoid derivative created by Organix Inc. for use in scientific research. Unlike most cannabinoids discovered to date, it is water-soluble, which gives it considerable advantages over many related cannabinoids. It has high affinity for both CB1 and CB2 receptors, with Ki values of 1.5 nM at CB1 and 0.32 nM at CB2.{{cite journal | vauthors = Martin BR, Wiley JL, Beletskaya I, Sim-Selley LJ, Smith FL, Dewey WL, Cottney J, Adams J, Baker J, Hill D, Saha B, Zerkowski J, Mahadevan A, Razdan RK | title = Pharmacological characterization of novel water-soluble cannabinoids | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 318 | issue = 3 | pages = 1230–9 | date = September 2006 | pmid = 16757541 | doi = 10.1124/jpet.106.104109 | s2cid = 14864925 }}

See also

References