:Octalene

{{For|insecticide|Aldrin}}

{{chembox

| ImageFile = Octalene.svg

| ImageSize = 200px

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid =

| IUPACName = Octalene

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 257-55-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = X4JL62R2HN

| PubChem = 136075

| EINECS = 206-215-8

| ChEBI = 33084

| ChemSpiderID = 119852

| SMILES = C1=CC=CC2=C(C=C1)C=CC=CC=C2

| InChI = 1/C14H12/c1-2-6-10-14-12-8-4-3-7-11-13(14)9-5-1/h1-12H/b2-1-,4-3-,5-1-,6-2-,7-3-,8-4-,9-5-,10-6-,11-7-,12-8-,13-9-,13-11-,14-10-,14-12-,14-13-

| InChIKey = OVPVGJFDFSJUIG-VFLSUHNHBC

| StdInChI = 1S/C14H12/c1-2-6-10-14-12-8-4-3-7-11-13(14)9-5-1/h1-12H/b2-1-,4-3-,5-1-,6-2-,7-3-,8-4-,9-5-,10-6-,11-7-,12-8-,13-9-,13-11-,14-10-,14-12-,14-13-

| StdInChIKey = OVPVGJFDFSJUIG-VFLSUHNHSA-N

}}

|Section2={{Chembox Properties

| C=14|H=12

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section7={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Octalene is a polycyclic hydrocarbon composed of two fused cyclooctatetraene rings.{{cite journal|doi=10.1021/jo00190a026 | volume=49 | title=Theoretical studies on octalene: the planar and nonplanar structures and the isomerization reactions among the nonplanar structures | year=1984 | journal=The Journal of Organic Chemistry | pages=2988–2993 | last1 = Koseki | first1 = S. | last2 = Kataoka | first2 = M. | last3 = Hanamura | first3 = M. | last4 = Nakajima | first4 = T. | last5 = Toyota | first5 = A.| issue=16 }}

Anions

Octalene can be readily reduced by lithium to a dianion {{chem2|C14H12(2-)}} and, unusually for such a small molecule, a tetraanion {{chem2|C14H12(4-)}}.Müllen, K., Oth, J. F. M., Engels, H.-W. and Vogel, E. (1979), Dianion and Tetraanion Octalene. Angew. Chem. Int. Ed. Engl., 18: 229–231. doi:10.1002/anie.197902291 The di-anion has its two negative charges in one ring, converting that ring into a 10-pi electron aromatic system similar to the di-anion of cyclooctatetraene. In the 18-pi electron tetra-anion, both rings effectively have access to 10 pi electrons, leading to a planar, bicyclic aromatic structure analogous to that of naphthalene.

See also

References