:Oxalosuccinic acid

{{More citations needed|date=May 2019}}

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444775363

| ImageFile = Oxalbernsteinsäure.png

| ImageClass = skin-invert

| PIN = 1-Oxopropane-1,2,3-tricarboxylic acid

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 1948-82-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = DFK99PW32K

| PubChem = 972

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 7815

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 947

| RTECS =

| MeSHName =

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C05379

| SMILES = C(C(C(=O)C(=O)O)C(=O)O)C(=O)O

| InChI = 1/C6H6O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2H,1H2,(H,7,8)(H,10,11)(H,12,13)

| InChIKey = UFSCUAXLTRFIDC-UHFFFAOYAK

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C6H6O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2H,1H2,(H,7,8)(H,10,11)(H,12,13)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = UFSCUAXLTRFIDC-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=6 | H=6 | O=7

| MolarMass = 190.108

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Oxalosuccinic acid is a substrate of the citric acid cycle. It is acted upon by isocitrate dehydrogenase. Salts and esters of oxalosuccinic acid are known as oxalosuccinates.

Oxalosuccinic acid/oxalosuccinate is an unstable 6-carbon intermediate in the tricarboxylic acid cycle. It's a keto acid, formed during the oxidative decarboxylation of isocitrate to alpha-ketoglutarate, which is catalyzed by the enzyme isocitrate dehydrogenase. Isocitrate is first oxidized by coenzyme NAD+ to form oxalosuccinic acid/oxalosuccinate.{{cite journal | vauthors = Ochoa S | title = Biosynthesis of tricarboxylic acids by carbon dioxide fixation; the preparation and properties of oxalosuccinic acid | journal = The Journal of Biological Chemistry | volume = 174 | issue = 1 | pages = 115–22 | date = May 1948 | doi = 10.1016/S0021-9258(18)57381-6 | pmid = 18914069 | doi-access = free }} Oxalosuccinic acid is both an alpha-keto and a beta-keto acid (an unstable compound) and it is the beta-ketoic property that allows the loss of carbon dioxide in the enzymatic reaction in conversion to the five-carbon molecule 2-oxoglutarate.{{cite journal | vauthors = Romkina AY, Kiriukhin MY | title = Biochemical and molecular characterization of the isocitrate dehydrogenase with dual coenzyme specificity from the obligate methylotroph Methylobacillus Flagellatus | journal = PLOS ONE | volume = 12 | issue = 4 | pages = e0176056 | date = 2017-04-19 | pmid = 28423051 | pmc = 5397045 | doi = 10.1371/journal.pone.0176056 | bibcode = 2017PLoSO..1276056R | doi-access = free }}