:PPADS

{{Chembox

| ImageFile = PPADS.svg

| ImageSize = 200px

| IUPACName = 4-[(E)-{4-formyl-5-hydroxy-6-methyl-3-[(phosphonooxy)methyl]pyridin-2-yl}diazenyl]benzene-1,3-disulfonic acid

| OtherNames = PPADS

|Section1={{Chembox Identifiers

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = L6K2LJ9BJK

| CASNo = 149017-66-3

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo1 = 192575-19-2

| CASNo1_Ref = {{cascite|correct|CAS}}

| CASNo1_Comment = (tetrasodium salt)

| PubChem = 6093163

| PubChem1 = 6532796

| PubChem1_Comment = (tetrasodium salt)

| ChemSpiderID = 20136164

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 34941

| SMILES = Oc2c(C=O)c(COP(O)(=O)O)c(/N=N/c1ccc(cc1S(O)(=O)=O)S(O)(=O)=O)nc2C

| InChI = InChI=1S/C14H14N3O12PS2/c1-7-13(19)9(5-18)10(6-29-30(20,21)22)14(15-7)17-16-11-3-2-8(31(23,24)25)4-12(11)32(26,27)28/h2-5,19H,6H2,1H3,(H2,20,21,22)(H,23,24,25)(H,26,27,28)/b17-16+

}}

|Section2={{Chembox Properties

| C=14 | H=14 | N=3 | O=12 | P=1 | S=2

| Appearance = Orange solid

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = 100 mM (tetrasodium salt)[http://www.scbt.com/datasheet-202770-ppads-tetrasodium-salt.html PPADS tetrasodium salt], Santa Cruz Biotechnology

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

PPADS (pyridoxalphosphate-6-azophenyl-2',4'-disulfonic acid) is a selective purinergic P2X antagonist.{{cite journal|last=Ziganshin|first=AU|title=PPADS selectively antagonizes P2X-purinoceptor-mediated responses in the rabbit urinary bladder.|journal=British Journal of Pharmacology|date=December 1993|volume=110|issue=4|pages=1491–95|pmid=8306091|pmc=2175839|doi=10.1111/j.1476-5381.1993.tb13990.x}} It is able to block contractions of rabbit vas deferens induced by ATP or α,β,methylene-ATP. It appears to be relatively selective for P2X receptors, having no appreciable activity at α₁ adrenergic, muscarinic M₂ and M₃, histamine H₁, and adenosine A₁ receptors.{{cite journal|last=Lambrecht|first=G.|title=PPADS, a novel functionally selective antagonist of P2 purinoreceptor mediated responses|journal=European Journal of Pharmacology|year=1992|volume=217|issue=2–3|pages=217–19|doi=10.1016/0014-2999(92)90877-7|pmid=1330591}}