:Padimate A

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 450847988

| ImageFile=Padimate A.png

| ImageSize=

| PIN=3-Methylbutyl 4-(dimethylamino)benzoate

| OtherNames=isoamyl dimethyl PABA
Escalol 506, 4-dimethylaminobenzoic acid isopentyl ester

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 80159

| SMILES = CC(C)CCOC(=O)c1ccc(cc1)N(C)C

| InChI = 1/C14H21NO2/c1-11(2)9-10-17-14(16)12-5-7-13(8-6-12)15(3)4/h5-8,11H,9-10H2,1-4H3

| InChIKey = OFSAUHSCHWRZKM-UHFFFAOYAM

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C14H21NO2/c1-11(2)9-10-17-14(16)12-5-7-13(8-6-12)15(3)4/h5-8,11H,9-10H2,1-4H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = OFSAUHSCHWRZKM-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=21245-01-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 956679A27P

| PubChem = 88836

}}

|Section2={{Chembox Properties

| Formula=C₁₄H₂₁NO₂

| MolarMass=235.322

| Appearance=

| Density=

| MeltingPt=<25 °C

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Padimate A is an organic compound that is an ingredient in some sunscreens. It is an ester derivative of PABA. This aromatic chemical absorbs ultraviolet rays thereby preventing sunburn. However, its chemical structure and behaviour is similar to an industrial free radical generator. In Europe this chemical was withdrawn in 1989 for unstated reasons.{{cite journal |doi=10.1016/0014-5793(93)80141-G |author1=Knowland, John |author2=McKenzie, Edward A. |author3=McHugh, Peter J. |author4=Cridland, Nigel A. |title= Sunlight-induced mutagenicity of a common sunscreen ingredient. | journal= FEBS Letters |volume= 324 |pages=309–313 |year=1993 | issue=3 |pmid=8405372|bibcode=1993FEBSL.324..309K |s2cid=23853321 }}

In the US it was never approved for use in sunscreens.