:Panaxatriol

{{distinguish|panaxytriol}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 382025554

| ImageFile=Panaxatriol.png

| ImageSize=200px

| IUPACName=(20R)-20,25-Epoxydammarane-3β,6β,12β-triol

| SystematicName=(1S,3aR,3bR,5R,5aR,7S,9aR,9bR,11R,11aR)-3a,3b,6,6,9a-Pentamethyl-1-[(2R)-2,6,6-trimethyloxan-2-yl]hexadecahydro-1H-cyclopenta[a]phenanthrene-5,7,11-triol

| OtherNames=

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=32791-84-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9F5B25FDDG

| PubChem=73599

| SMILES=C[C@@]1(CCCC(O1)(C)C)[C@H]2CC[C@@]3([C@@H]2[C@@H](C[C@H]4[C@]3(C[C@H]([C@@H]5[C@@]4(CC[C@@H](C5(C)C)O)C)O)C)O)C

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 66270

| InChI = 1/C30H52O4/c1-25(2)12-9-13-30(8,34-25)18-10-15-28(6)23(18)19(31)16-21-27(5)14-11-22(33)26(3,4)24(27)20(32)17-29(21,28)7/h18-24,31-33H,9-17H2,1-8H3/t18-,19+,20+,21+,22-,23-,24-,27+,28+,29+,30+/m0/s1

| InChIKey = QFJUYMMIBFBOJY-UXZRXANABD

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C30H52O4/c1-25(2)12-9-13-30(8,34-25)18-10-15-28(6)23(18)19(31)16-21-27(5)14-11-22(33)26(3,4)24(27)20(32)17-29(21,28)7/h18-24,31-33H,9-17H2,1-8H3/t18-,19+,20+,21+,22-,23-,24-,27+,28+,29+,30+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QFJUYMMIBFBOJY-UXZRXANASA-N

}}

|Section2={{Chembox Properties

| C=30 | H=52 | O=4

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Panaxatriol is an organic compound that is an aglycone of ginsenosides, a group of steroid glycosides.{{cite journal | doi = 10.1016/0024-3205(95)00124-o | title = Ginsenosides of the protopanaxatriol group cause endothelium-dependent relaxation in the rat aorta | date = 1995 | last1 = Kang | first1 = Soo Yeon | last2 = Schini-Kerth | first2 = Valérie B. | last3 = Kim | first3 = Nak Doo | journal = Life Sciences | volume = 56 | issue = 19 | pages = 1577–1586 | pmid = 7723586 }} It is a dammarane-type tetracyclic triterpene sapogenin found in ginseng (Panax ginseng) and in notoginseng (Panax pseudoginseng). It is formed by the dehydration of protopanaxatriol.