:Pentamine

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = Ethyl-[2-[2-(ethyl-dimethyl-ammonio)ethyl-methyl-amino]ethyl]-dimethyl-ammonium

| image = Pentamine.svg

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 60-30-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 43XK6AW58D

| ATC_prefix =

| ATC_suffix =

| PubChem = 9383

| ChemSpiderID = 9014

| C=13 | H=33 | N=3

| smiles = CC[N+](C)(C)CCN(C)CC[N+](C)(C)CC

| StdInChI=1S/C13H33N3/c1-8-15(4,5)12-10-14(3)11-13-16(6,7)9-2/h8-13H2,1-7H3/q+2

| StdInChIKey = NHWGPUVJQFTOQX-UHFFFAOYSA-N

}}

Pentamine is a pharmaceutical drug that acts as a ganglionic blocker.{{cite journal | title = The effect of ganglioblocking agents on synaptic transmission of nervous excitation in the sympathetic ganglia | year = 1963 | vauthors = Kharkevich DA | journal = Bulletin of Experimental Biology and Medicine | volume = 54 | pages = 749–752 | s2cid = 848381 | doi = 10.1007/BF00785866 }}