:Perfluoro-1,3-dimethylcyclohexane
{{chembox
| ImageFile=Perfluoro-1,3-dimethylcyclohexane.svg
|ImageSize=200px
|IUPACName=1,1,2,2,3,3,4,5,5,6-Decafluoro-4,6-bis(trifluoromethyl)cyclohexane
|OtherNames=Flutec PP3
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10628076
| CASNo=335-27-3
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q1Y54IOL0P
| InChIKey= LOQGSOTUHASIHI-UHFFFAOYSA-N
| EINECS = 206-386-9
| PubChem=78975
| SMILES = FC(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C1(F)F
}}
|Section2={{Chembox Properties
| C=8 | F=16
| Appearance=Clear, colorless liquid
| Density=1.828 g/mL
| MeltingPtC=-70
| BoilingPtC=102
| Solubility=10 ppm
}}
|Section3= {{Chembox Hazards
| MainHazards=None
| FlashPt=None
}}
}}
Perfluoro-1,3-dimethylcyclohexane is a fluorocarbon liquid—a perfluorinated derivative of the hydrocarbon 1,3-dimethylcyclohexane. It is chemically and biologically inert.
Manufacture
Perfluoro-1,3-dimethylcyclohexane can be manufactured by the Fowler process, which involves moderating the action of elemental fluorine with cobalt fluoride in the gas phase from meta-xylene. This is preferred as the starting material over 1,3-dimethylcyclohexane as less fluorine is required.{{cite journal |author=Sandford G |title=Perfluoroalkanes |journal=Tetrahedron |volume=59 |pages=437–454 |year=2003 |issue=4|doi=10.1016/s0040-4020(02)01568-5}}
Properties
Perfluoro-1,3-dimethylcyclohexane is chemically inert and thermally stable (to over 400 °C).
It is a clear, colorless liquid, with a relatively high density, low viscosity and low surface tension that will rapidly evaporate. It is a relatively good solvent for gases, but a poor solvent for solids and liquids.{{cite web | url = http://www.f2chemicals.com/pdf/technical/Liquid%20solubility.pdf | title = Solubility in Liquids | publisher = F2 Chemicals}}
In common with other cyclic perfluorocarbons, perfluoro-1,3-dimethylcyclohexane can be detected at extremely low concentrations, making it ideal as a tracer.{{cite journal | title = Femtogram detection of perfluorocarbon tracers using capillary gas chromatography-electron-capture negative ion chemical ionisation mass spectrometry. | year = 1988 |author=Begley P1 |author2=Foulger B |author3=Simmonds P. | journal = J. Chromatogr. | volume = 445 | issue = 1 | pages = 119–128 | doi=10.1016/s0021-9673(01)84513-1| pmid = 3215967 }}