:Pericine

{{cs1 config|name-list-style=vanc}}

{{Chembox

| verifiedrevid = 450846495

| ImageFile = Pericine.svg

| ImageClass = skin-invert-image

| ImageSize =

| ImageAlt =

| IUPACName = (1R,16E)-16-Ethylidene-2-methylene-4,14-diazatetracyclo[12.2.2.0^3,11.0^5,10]octadeca-3(11),5,7,9-tetraene

| OtherNames = Subincanadine E

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 84638-28-8

| PubChem = 6440735

| UNII = 56UJL0958V

| ChemSpiderID = 4944986

| SMILES = C/C=C\1/CN2CCc3c4ccccc4[nH]c3C(=C)[C@@H]1CC2

| StdInChI = 1S/C19H22N2/c1-3-14-12-21-10-8-15(14)13(2)19-17(9-11-21)16-6-4-5-7-18(16)20-19/h3-7,15,20H,2,8-12H2,1H3/b14-3-/t15-/m0/s1

| StdInChIKey = VAUGOKMDSLQYNG-WNDJQJCJSA-N

}}

| Section2 = {{Chembox Properties

| C=19 | H=22 | N=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Pericine is one of a number of indole alkaloids found in the tree Picralima nitida, commonly known as akuamma. As with some other alkaloids from this plant such as akuammine, pericine has been shown to bind to mu opioid receptors in vitro, and has an IC₅₀ of 0.6 μmol, within the range of a weak analgesic.{{cite journal | vauthors = Arens H, Borbe HO, Ulbrich B, Stöckigt J | title = Detection of pericine, a new CNS-active indole alkaloid from Picralima nitida cell suspension culture by opiate receptor binding studies | journal = Planta Medica | volume = 46 | issue = 4 | pages = 210–4 | date = December 1982 | pmid = 6298847 | doi = 10.1055/s-2007-971216 | s2cid = 7758884 }} It may also have convulsant effects.{{cite book | vauthors = Roberts MF, Wink M | title = Alkaloids: Biochemistry, Ecology, and Medicinal Applications | date = 30 June 1998 | pages = 68–69 | publisher = Springer | isbn = 978-0-306-45465-3 }}

Pericine has been prepared in the laboratory by total synthesis.{{cite journal | vauthors = Tian J, Du Q, Guo R, Li Y, Cheng B, Zhai H | title = Total synthesis of indole alkaloid (±)-subincanadine E | journal = Organic Letters | volume = 16 | issue = 12 | pages = 3173–5 | date = June 2014 | pmid = 24869784 | doi = 10.1021/ol501308p }}{{cite journal | vauthors = Kalshetti MG, Argade NP | title = Total Synthesis of (±)/(+)-Subincanadine E and Determination of Absolute Configuration | journal = The Journal of Organic Chemistry | volume = 82 | issue = 20 | pages = 11126–11133 | date = October 2017 | pmid = 28952728 | doi = 10.1021/acs.joc.7b02122 }}