:Perillartine

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 414430901

| ImageFileL1 = Perillartine chemical structure.png

| ImageSizeL1 = 80px

| ImageNameL1 = Skeletal formula

| ImageFileR1 =S-Perillartine-3D-balls.png

| ImageSizeR1 = 160px

| ImageNameR1 = Ball-and-stick model

| IUPACName = (S)-4-(Prop-1-en-2-yl)cyclohex-1-ene- carbaldehyde oxime

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 30950-27-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 46S302515I

| SMILES = CC([C@H]1CCC(/C=N/O)=CC1)=C

| PubChem = 5365782

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4517728

| InChI = 1/C10H15NO/c1-8(2)10-5-3-9(4-6-10)7-11-12/h3,7,10,12H,1,4-6H2,2H3/b11-7+

| InChIKey = XCOJIVIDDFTHGB-YRNVUSSQBY

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C10H15NO/c1-8(2)10-5-3-9(4-6-10)7-11-12/h3,7,10,12H,1,4-6H2,2H3/b11-7+

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = XCOJIVIDDFTHGB-YRNVUSSQSA-N

}}

|Section2={{Chembox Properties

| Formula = C₁₀H₁₅NO

| MolarMass = 165.23 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Perillartine, also known as perillartin and perilla sugar, is a semisynthetic sweetener that is about 2000 times as sweet as sucrose. It is mainly used in Japan.[https://books.google.com/books?id=aeMH0F5Z4q4C&pg=PA221 Alternative Sweeteners] Lyn O'Brien Nabors, Robert C. Gelardi. {{ISBN|0-8247-0437-1}}, {{ISBN|978-0-8247-0437-7}}. CRC, 3rd edition 2001.

Perillartine is the oxime of perillaldehyde, which is extracted from plants of the genus Perilla (Lamiaceae).