:Phellodendrine
{{chembox
| Reference =
| Name = Phellodendrine
| ImageFile1 = Phellodendrine.png
| ImageSize1 =
| ImageFile2 =
| ImageSize2 =
| IUPACName = 2,11-Dihydroxy-3,10-dimethoxyberbin-7α-ium
| SystematicName = (7S,13aS)-2,11-Dihydroxy-3,10-dimethoxy-7-methyl-5,8,13,13a-tetrahydro-6H-isoquinolino[3,2-a]isoquinolin-7-ium
| OtherNames =
|Section1={{Chembox Identifiers
| InChI = 1/C20H23NO4/c1-21-5-4-12-8-19(24-2)18(23)10-15(12)16(21)6-13-7-17(22)20(25-3)9-14(13)11-21/h7-10,16H,4-6,11H2,1-3H3,(H-,22,23)/p+1/t16-,21-/m0/s1
| InChIKey = RBBVPNQTBKHOEQ-ZJYUTNJKBY
| PubChem = 3081405
| CASNo = 6873-13-8
| ChemSpiderID = 2339019
| SMILES = O(c1cc3c(cc1O)C[C@H]4c2c(cc(OC)c(O)c2)CC[N@+]4(C3)C)C
}}
|Section2={{Chembox Properties
| Formula = C20H24NO4
| MolarMass = 342.4083 g/mol
| Density =
| MeltingPtC = 258
| MeltingPt_notes = (as iodide)
| BoilingPt =
| Solubility =
}}
}}
Phellodendrine is an alkaloid isolated originally from Phellodendron amurense (Rutaceae).{{cite journal |vauthors=SHIMAMOTO K, JUJIHARA M, TORII H |title=[Pharmacological studies on phellodendrine, the quaternary ammonium alkaloid isolated from Phellodendron amurense, a type of Rutaceae.] |language=ja |journal=Nippon Yakurigaku Zasshi. Folia Pharmacologica Japonica |volume=58 |pages=138–49 |date=March 1962 |pmid=13911932 |doi= 10.1254/fpj.58.138|doi-access=free }}{{cite journal |vauthors=Mori H, Fuchigami M, Inoue N, Nagai H, Koda A, Nishioka I, Meguro K |title=Principle of the bark of Phellodendron amurense to suppress the cellular immune response: effect of phellodendrine on cellular and humoral immune responses |journal=Planta Medica |volume=61 |issue=1 |pages=45–9 |date=February 1995 |pmid=7700991 |doi=10.1055/s-2006-957997 }}